Succinimidyl 4-formylbenzoate manufacturers
- Ald-Ph-NHS ester
-
- $33.00
-
2026-07-15
- CAS:60444-78-2
- Purity: 99.47%
- Supply Ability: 10g
|
| | Succinimidyl 4-formylbenzoate Basic information |
| | Succinimidyl 4-formylbenzoate Chemical Properties |
| Melting point | 163°C | | Boiling point | 425.4±47.0 °C(Predicted) | | density | 1.44±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | methanol: soluble50mg/mL, clear to very faintly turbid, colorless | | form | Solid | | color | White to Pale Yellow | | Water Solubility | Water: < 0.1 mg/mL (insoluble) | | λmax | 274nm(lit.) | | InChI | InChI=1S/C12H9NO5/c14-7-8-1-3-9(4-2-8)12(17)18-13-10(15)5-6-11(13)16/h1-4,7H,5-6H2 | | InChIKey | VHYRHFNOWKMCHQ-UHFFFAOYSA-N | | SMILES | C(ON1C(=O)CCC1=O)(=O)C1=CC=C(C=O)C=C1 |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29280000 |
| | Succinimidyl 4-formylbenzoate Usage And Synthesis |
| Chemical Properties | Off-White to Pale Yellow Solid | | Uses | Ald-Ph-NHS ester is a nonclaevable linker for antibody-agent-conjugation (ADC). | | IC 50 | Non-cleavable Linker |
| | Succinimidyl 4-formylbenzoate Preparation Products And Raw materials |
|