| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
N-Succinimidyl 6-(2,4-dinitroanilino)hexanoate manufacturers
- DNP-X, SE
-
- $44.00
-
2026-08-08
- CAS:82321-04-8
- Purity: 98.39%
- Supply Ability: 10g
|
| | N-Succinimidyl 6-(2,4-dinitroanilino)hexanoate Basic information |
| Product Name: | N-Succinimidyl 6-(2,4-dinitroanilino)hexanoate | | Synonyms: | Hexanoic acid,6-[(2,4-dinitrophenyl)amino]-, 2,5-dioxo-1-pyrrolidinyl ester;N-(2,4-DINITROPHENYL)-6-AMINOHEXANOIC ACID N-SUCCINIMIDYL ESTER;6-(2,4-DINITROPHENYL)AMINOHEXANOIC ACID, SUCCINIMIDYL ESTER;DNP-X ACID, SE;DNP-X, SE;N-(2,4-Dinitrophenyl)-6-aminocaproic acid N-succinimidyl ester;Succinimidyldinitroanilinohexanoate;N-Succinimidyl N-(2,4-dinitrophenyl)-6-aminocaproate | | CAS: | 82321-04-8 | | MF: | C16H18N4O8 | | MW: | 394.34 | | EINECS: | | | Product Categories: | N-Substituted Maleimides, Succinimides & Phthalimides;N-Substituted Succinimides | | Mol File: | 82321-04-8.mol |  |
| | N-Succinimidyl 6-(2,4-dinitroanilino)hexanoate Chemical Properties |
| Melting point | 152 °C | | Boiling point | 591.8±60.0 °C(Predicted) | | density | 1.46±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | pka | -4.58±0.50(Predicted) | | form | Solid | | color | Light yellow to yellow | | Appearance | Solid Powder | | InChI | 1S/C16H18N4O8/c21-14-7-8-15(22)18(14)28-16(23)4-2-1-3-9-17-12-6-5-11(19(24)25)10-13(12)20(26)27/h5-6,10,17H,1-4,7-9H2 | | InChIKey | IYBNUJCDIAGXNX-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccc(NCCCCCC(=O)ON2C(=O)CCC2=O)c(c1)[N+]([O-])=O | | CAS DataBase Reference | 82321-04-8 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | N-Succinimidyl 6-(2,4-dinitroanilino)hexanoate Usage And Synthesis |
| Description | N-Succinimidyl N-(2,4-dinitrophenyl)-6-aminocaproate is an amine-reactive probe used in the synthesis of DNP labeled biomolecules. | | Uses | N-(2,4-Dinitrophenyl)-6-aminocaproic acid N-succinimidyl ester is an amine-reactive DNP-X succinimidyl ester that may be used to create bioconjugates that may be detected with anti-dinitrophenyl (anti-DNP) antibodies. |
| | N-Succinimidyl 6-(2,4-dinitroanilino)hexanoate Preparation Products And Raw materials |
|