|
|
| | (R)-N-Boc-3-Bromophenylalanine Basic information |
| | (R)-N-Boc-3-Bromophenylalanine Chemical Properties |
| Boiling point | 475.3±40.0 °C(Predicted) | | density | 1.5311 (rough estimate) | | refractive index | 1.6500 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | Powder | | pka | 3.81±0.10(Predicted) | | color | White | | InChI | InChI=1S/C14H18BrNO4/c1-14(2,3)20-13(19)16-11(12(17)18)8-9-5-4-6-10(15)7-9/h4-7,11H,8H2,1-3H3,(H,16,19)(H,17,18)/t11-/m1/s1 | | InChIKey | FBUDYESOPLBQIR-LLVKDONJSA-N | | SMILES | C(O)(=O)[C@@H](CC1=CC=CC(Br)=C1)NC(OC(C)(C)C)=O | | CAS DataBase Reference | 261360-77-4(CAS DataBase Reference) |
| Safety Statements | 24/25 | | HazardClass | IRRITANT | | HS Code | 2924297099 |
| Provider | Language |
|
ACROS
| English |
| | (R)-N-Boc-3-Bromophenylalanine Usage And Synthesis |
| Chemical Properties | off-white crystalline powder | | Uses | (R)-3-(3-Bromophenyl)-2-((tert-butoxycarbonyl)amino)propanoic acid is a phenylalanine derivative[1]. | | References | [1] Luckose F, et al. Effects of amino acid derivatives on physical, mental, and physiological activities. Crit Rev Food Sci Nutr. 2015;55(13):1793-959. DOI:10.1080/10408398.2012.708368 |
| | (R)-N-Boc-3-Bromophenylalanine Preparation Products And Raw materials |
|