| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- Fmoc-D-Asn-OH
-
-
2026-08-08
- CAS:108321-39-7
- Min. Order: 1Box
- Purity: 99%
- Supply Ability: 200kg
- Fmoc-D-Asparagine
-
- $1.00
-
2019-07-06
- CAS:108321-39-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
|
| | Fmoc-D-Asparagine Basic information |
| | Fmoc-D-Asparagine Chemical Properties |
| Melting point | ~185 °C (dec.) | | alpha | 11.9 º (c=1%, DMF) | | Boiling point | 678.6±55.0 °C(Predicted) | | density | 1.362±0.06 g/cm3(Predicted) | | refractive index | 12 ° (C=1, DMF) | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in water or 1% acetic acid | | pka | 3.68±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]20/D +11.9±1.5°, c = 1% in DMF | | BRN | 8510210 | | Major Application | peptide synthesis | | InChI | InChI=1S/C19H18N2O5/c20-17(22)9-16(18(23)24)21-19(25)26-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16H,9-10H2,(H2,20,22)(H,21,25)(H,23,24)/t16-/m1/s1 | | InChIKey | YUGBZNJSGOBFOV-MRXNPFEDSA-N | | SMILES | C(O)(=O)[C@@H](CC(N)=O)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | | CAS DataBase Reference | 108321-39-7(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29242100 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-D-Asparagine Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | Nα-Fmoc-D-asparagine is an N-Fmoc-protected form of D-Asparagine (A788990). D-Asparagine is an isomer of L-Asparagine (A790005) and is used by bacteria (such as Saccharomyces cerevisiae) as a sole nitrogen source for replication. L-Asparagine is also a competitive inhibitor of staphylococcal L-asparaginase and is used as a reagent to synthesize peptide antibiotics. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-D-Asparagine Preparation Products And Raw materials |
|