- azido-PEG6-amine
-
-
2025-06-07
- CAS:957486-82-7
- Min. Order: 1g
- Purity: >98.00%
- Supply Ability: 1g
|
| | 20-Azido-3,6,9,12,15,18-hexaoxaeicosan-1-amine Basic information |
| Product Name: | 20-Azido-3,6,9,12,15,18-hexaoxaeicosan-1-amine | | Synonyms: | 2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine;O-(2-AMINOETHYL)-O'-(2-AZIDOETHYL)NONAETHYLENE GLYCOL;O-(2-AMINOETHYL)-O'-(2-AZIDOETHYL)PENTAETHYLENE GLYCOL;Azido-PEG-amine (n=6);O-(2-Aminoethyl)-O'-(2-azidoethyl)pentaethylene glycol >=90% (oligomer purity);20-Azido-3,6,9,12,15,18-hexaoxaeicosan-1-aMine;Amino-PEG7-azide;H2N-PEG(6)-N3 | | CAS: | 957486-82-7 | | MF: | C22H46N4O10 | | MW: | 526.62 | | EINECS: | | | Product Categories: | Heterobifunctional PEG;Aliphatics;Amines;Labeling and Diagnostics Reagents;Polyethyleneglycol Derivatives;Aliphatic Azides;Alkynes and Other Reagents;Azides;Building Blocks;Chemical Biology;Chemical Synthesis;Conjugation Chemistry: Azides;Heterobifunctional PEGs;High Oligomer Purity PEG;Materials Science;Nitrogen Compounds;Organic Building Blocks;PEG Azides;PEGylation;Poly(ethylene glycol) and Poly(ethylene oxide);Polymer Science;peg | | Mol File: | 957486-82-7.mol |  |
| | 20-Azido-3,6,9,12,15,18-hexaoxaeicosan-1-amine Chemical Properties |
| storage temp. | 2-8°C | | solubility | Soluble in Water, DMSO, DCM, DMF | | form | viscous liquid | | color | Colourless | | InChI | InChI=1S/C14H30N4O6/c15-1-3-19-5-7-21-9-11-23-13-14-24-12-10-22-8-6-20-4-2-17-18-16/h1-15H2 | | InChIKey | RMNAJNJBCBFOKX-UHFFFAOYSA-N | | SMILES | C(COCCOCCOCCN)OCCOCCOCCN=[N+]=[N-] |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10-23 | | HS Code | 2929900090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 20-Azido-3,6,9,12,15,18-hexaoxaeicosan-1-amine Usage And Synthesis |
| Description | Amino-PEG6-azide is a water soluble heterobifunctional PEG linker containing an amino group with an azide group. The amino group is reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. The azide group can react with alkyne, BCN, DBCO via Click Chemistry to yield a stable triazole linkage. | | Uses | AZIDO-PEG-AMINE is a heterobifunctional polyethyleneglycol (PEG) derivative used in the preparation low-fouling, biofunctionalized, and biodegradable click capsules; a useful reagent used in the construction of intramolecular linkers. | | Uses | O-(2-Aminoethyl)-O′-(2-azidoethyl)pentaethylene glycol has been used in the synthesis of Alexa568-azide, a fluorescent azide that can undergo click staining reaction with 5-ethynyluridine-labeled cellular RNA. | | reaction suitability | reaction type: click chemistry
reagent type: cross-linking reagent | | IC 50 | PEGs; Non-cleavable Linker |
| | 20-Azido-3,6,9,12,15,18-hexaoxaeicosan-1-amine Preparation Products And Raw materials |
|