- Adonitol
-
-
2026-08-21
- CAS:488-81-3
- Min. Order: 100g
- Purity: 98.5%min
- Supply Ability: 10KG
- D-Ribitol
-
-
2026-07-22
- CAS:488-81-3
- Min. Order: 100G
- Purity: 99%
- Supply Ability: 10KG
- ADONITOL
-
-
2026-06-30
- CAS:488-81-3
- Min. Order: 1KG
- Purity: 98
- Supply Ability: 10000KGS
|
| | ADONITOL Basic information |
| | ADONITOL Chemical Properties |
| Melting point | 102-105 °C | | Boiling point | 194.6°C (rough estimate) | | density | 1.1497 (rough estimate) | | refractive index | 1.3920 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMF: 5mg/mL; DMSO: 25mg/mL; PBS (pH 7.2): 5mg/mL | | form | Fine Crystalline Powder | | pka | 13.24±0.20(Predicted) | | color | White | | PH | 5.5-7.0 (100g/l, H2O, 25℃) | | Water Solubility | Soluble in water (100 mg/ml). | | Sensitive | Hygroscopic | | Merck | 14,168 | | BRN | 1720524 | | Henry's Law Constant | 4.6×1011 mol/(m3Pa) at 25℃, Compernolle and Müller (2014) | | Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. | | InChI | 1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5- | | InChIKey | HEBKCHPVOIAQTA-ZXFHETKHSA-N | | SMILES | OC[C@H](O)[C@H](O)[C@H](O)CO | | LogP | -3.770 (est) | | CAS DataBase Reference | 488-81-3(CAS DataBase Reference) | | EPA Substance Registry System | Ribitol (488-81-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-36-26 | | WGK Germany | 3 | | RTECS | VJ0800000 | | F | 3-10 | | TSCA | TSCA listed | | HS Code | 29054990 | | Storage Class | 11 - Combustible Solids |
| | ADONITOL Usage And Synthesis |
| Chemical Properties | White powder | | Uses | A sugar alcohol formed by the reduction of ribose | | Uses | Adonitol is metabolized to teicholic acids used in the cell walls of gram positive bacteria. Adonitol is often compared to other cell permeating molecules such as formamide, propanediol, and DMSO as a cryopreservation agent. | | Definition | ChEBI: A ribitol compound having meso-configuration. It occurs naturally in the plant Adonis vernalis. | | General Description | Adonitol (Ribitol), a pentose alcohol, is metabolized to teicholic acids used in the cell walls of gram positive bacteria. Adonitol is often compared to other cell permeating molecules such as formamide, propanediol, and DMSO as a cryopreservation agent. |
| | ADONITOL Preparation Products And Raw materials |
|