2'-HYDROXY-3',4'-DIMETHOXYACETOPHENONE manufacturers
|
| | 2'-HYDROXY-3',4'-DIMETHOXYACETOPHENONE Basic information |
| | 2'-HYDROXY-3',4'-DIMETHOXYACETOPHENONE Chemical Properties |
| Melting point | 75-77°C | | Boiling point | 308.1±37.0 °C(Predicted) | | density | 1.172±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform, Methanol | | form | powder | | pka | 9.79±0.15(Predicted) | | color | Off-White | | InChI | InChI=1S/C10H12O4/c1-6(11)7-4-5-8(13-2)10(14-3)9(7)12/h4-5,12H,1-3H3 | | InChIKey | BCEPNLMYVYJIHU-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(OC)C(OC)=C1O)C | | CAS DataBase Reference | 5396-18-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | HS Code | 29145090 | | Storage Class | 11 - Combustible Solids |
| | 2'-HYDROXY-3',4'-DIMETHOXYACETOPHENONE Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | Gallacetophenone 3’,4’-Dimethyl ether is a phenolic compound with potential 2,2-diphenyl-1-picrylhydrazyl (DPPH) radical-scavenging activity. | | Preparation | Preparation by reaction of acetyl chloride on pyrogallol trimethyl ether,with aluminium chloride in carbon disulfide, in boiling ethyl ether (77%) or in benzene at 45–50° (77%) with mercuric chloride without solvent at 100° (40%). |
| | 2'-HYDROXY-3',4'-DIMETHOXYACETOPHENONE Preparation Products And Raw materials |
| Raw materials | 2,3-Dimethoxyphenol acetate-->2',3',4'-TRIMETHOXYACETOPHENONE-->2',3',4'-TRIHYDROXYACETOPHENONE-->3,4-Dimethoxyacetophenone-->2,3-Dimethoxyphenol-->Pyrogallol-->Acetyl chloride-->Dimethyl sulfate-->Iodomethane-->1,2,3-Trimethoxybenzene | | Preparation Products | 7,8-Dihydroxyflavone |
|