| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 5-Chloro-2-hydroxy-3-nitropyridine Basic information |
| | 5-Chloro-2-hydroxy-3-nitropyridine Chemical Properties |
| Melting point | 232-236 °C | | Boiling point | 284.1±40.0 °C(Predicted) | | density | 1.61±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | soluble in Dimethylformamide | | form | powder to crystal | | pka | 6.31±0.10(Predicted) | | color | Light yellow to Yellow to Green | | BRN | 383852 | | InChI | 1S/C5H3ClN2O3/c6-3-1-4(8(10)11)5(9)7-2-3/h1-2H,(H,7,9) | | InChIKey | QVGQNICXNZMXQA-UHFFFAOYSA-N | | SMILES | Oc1ncc(Cl)cc1[N+]([O-])=O | | CAS DataBase Reference | 21427-61-2(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-41-37/38-22 | | Safety Statements | 26-36/37/39-39-36-37 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29337900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | 5-Chloro-2-hydroxy-3-nitropyridine Usage And Synthesis |
| Chemical Properties | White to light brown solid | | Uses | 5-Chloro-2-hydroxy-3-nitropyridine (cas# 21427-61-2) is a compound useful in organic synthesis. | | Synthesis | Preparation of Example A2 5-chloro-2-hydroxy-3-nitropyridine (STR9): 321 g of 2-amino-5-chloropyridine was slowly added dropwise to 1.25 L of concentrated sulfuric acid with continuous stirring until the raw material was completely dissolved. Subsequently, 172.5 g of sodium nitrite (dissolved in 240 mL of water) was slowly added at 40°C to 45°C and the reaction mixture continued to be stirred for 15 minutes. Next, 125 mL of pure nitric acid was slowly added dropwise over 40 minutes at 50°C. The reaction mixture was maintained at 55°C for 1 hour and then the reaction was quenched by pouring into 5 kg of ice water. The yellow precipitated product was collected by filtration, washed thoroughly with deionized water and dried at 60°C to afford 351 g of 5-chloro-2-hydroxy-3-nitropyridine in 80.5% of the theoretical yield and a melting point of 229°C to 231°C. | | References | [1] Patent: US5274100, 1993, A
[2] Yakugaku Zasshi, 1952, vol. 72, p. 431
[3] Chem.Abstr., 1953, p. 6404 |
| | 5-Chloro-2-hydroxy-3-nitropyridine Preparation Products And Raw materials |
|