|
|
| | 2 3 4 6-Tetra-O-benzyl-alpha-D-glucopyr& Basic information |
| Product Name: | 2 3 4 6-Tetra-O-benzyl-alpha-D-glucopyr& | | Synonyms: | 2,3,4,6-tetra-o-benzyl-α-d-glucopyranosyl trichloroacetimidate;2,3,4,6-Tetra-O-benzyl-a-D-glucopyranosyltrichloroacetimidate;2,3,4,6-Tetra-O-benzyl-α-D-glucopyranosyl trichloroacetimidate ,95%;2,3,4,6-Tetra-O-benzyl-;(3R,4S,5R,6R)-3,4,5-tris(benzyloxy)-6-((benzyloxy)methyl)tetrahydro-2H-pyran-2-yl 2,2,2-trichloroacetimidate;(2R,3R,4S,5R,6R)-3,4,5-Tris(benzyloxy)-6-((benzyloxy)methyl)tetrahydro-2H-pyran-2-yl 2,2,2-trichloroacetimidate;2,3,4,6-Tetra-O-benzyl-α-D-glucopyranosyl trichloroacetimidate;α-D-Glucopyranose, 2,3,4,6-tetrakis-O-(phenylmethyl)-, 1-(2,2,2-trichloroethanimidate) | | CAS: | 74808-09-6 | | MF: | C36H36Cl3NO6 | | MW: | 685.03 | | EINECS: | | | Product Categories: | Chiral Building Blocks;Heterocyclic Building Blocks;Pyrans | | Mol File: | 74808-09-6.mol |  |
| | 2 3 4 6-Tetra-O-benzyl-alpha-D-glucopyr& Chemical Properties |
| Melting point | 69-74 °C (lit.) | | Boiling point | 696.0±65.0 °C(Predicted) | | density | 1.27±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 1.39±0.70(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | [α]20/D +58, c = 0.4 in chloroform | | InChIKey | LMICALCPRSCSMO-LGXFECBRNA-N | | SMILES | O([C@@H]1[C@H]([C@@H](OC(=N)C(Cl)(Cl)Cl)O[C@H](COCC2C=CC=CC=2)[C@H]1OCC1C=CC=CC=1)OCC1C=CC=CC=1)CC1C=CC=CC=1 |&1:1,2,3,12,22,r| |
| WGK Germany | 3 | | HS Code | 29400090 | | Storage Class | 11 - Combustible Solids |
| | 2 3 4 6-Tetra-O-benzyl-alpha-D-glucopyr& Usage And Synthesis |
| Chemical Properties | White to off-white crystalline powder |
| | 2 3 4 6-Tetra-O-benzyl-alpha-D-glucopyr& Preparation Products And Raw materials |
|