| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
N,N-DIPHENYLFORMAMIDE manufacturers
- N,N-DIPHENYLFORMAMIDE
-
- $1.00
-
2020-01-13
- CAS:607-00-1
- Min. Order: 1KG
- Purity: 85.0-99.8%
- Supply Ability: 200kgs
|
| | N,N-DIPHENYLFORMAMIDE Basic information |
| | N,N-DIPHENYLFORMAMIDE Chemical Properties |
| Melting point | 69-73 °C(lit.) | | Boiling point | 337 °C762 mm Hg(lit.) | | density | 1.1012 (rough estimate) | | refractive index | 1.6050 (estimate) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder to crystal | | pka | -2.73±0.50(Predicted) | | color | White to Light yellow to Light orange | | BRN | 2209397 | | InChI | 1S/C13H11NO/c15-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-11H | | InChIKey | DCNUQRBLZWSGAV-UHFFFAOYSA-N | | SMILES | [H]C(=O)N(c1ccccc1)c2ccccc2 | | CAS DataBase Reference | 607-00-1(CAS DataBase Reference) | | EPA Substance Registry System | Formamide, N,N-diphenyl- (607-00-1) |
| WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2924297099 | | Storage Class | 11 - Combustible Solids |
| | N,N-DIPHENYLFORMAMIDE Usage And Synthesis |
| | N,N-DIPHENYLFORMAMIDE Preparation Products And Raw materials |
|