| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Bromo-2-trifluoromethylpyridine Basic information |
| Product Name: | 4-Bromo-2-trifluoromethylpyridine | | Synonyms: | 2-(Trifluoromethyl)-4-bromopyridine;4-Bromo-2-(trifluoromethyl);EOS-61272;4-Bromo-alpha,alpha,alpha-trifluoro-2-picoline;4-Bromo-2-(trifL;Pyridine, 4-bromo-2-(trifluoromethyl)-;4-BROMO-2-TRIFLUOROMETHYLPYRIDINE ISO 9001：2015 REACH;4-Bromo-2-(trifluoromethyl)pyridine?New | | CAS: | 887583-90-6 | | MF: | C6H3BrF3N | | MW: | 225.99 | | EINECS: | | | Product Categories: | | | Mol File: | 887583-90-6.mol |  |
| | 4-Bromo-2-trifluoromethylpyridine Chemical Properties |
| Boiling point | 167.4±35.0 °C(Predicted) | | density | 1.707±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | pka | -1.23±0.10(Predicted) | | form | liquid | | color | Colourless | | InChI | InChI=1S/C6H3BrF3N/c7-4-1-2-11-5(3-4)6(8,9)10/h1-3H | | InChIKey | QHLLEZOPZRBCOY-UHFFFAOYSA-N | | SMILES | C1(C(F)(F)F)=NC=CC(Br)=C1 |
| | 4-Bromo-2-trifluoromethylpyridine Usage And Synthesis |
| Chemical Properties | Pale yellow powder | | Uses | 4-Bromo-2-(trifluoromethyl)pyridine is used in the synthesis of a potent and selective Class IIa histone deacetylase inhibitors as a potential therapy for Huntington’s disease. |
| | 4-Bromo-2-trifluoromethylpyridine Preparation Products And Raw materials |
|