| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2-Bromo-5-(trifluoromethyl)pyridine Basic information |
| | 2-Bromo-5-(trifluoromethyl)pyridine Chemical Properties |
| Melting point | 44-48 °C | | Boiling point | 78 °C | | density | 1.707±0.06 g/cm3(Predicted) | | Fp | 78-81°C/30mm | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Soluble in methanol and ethanol. | | form | Crystalline | | pka | -1+-.0.10(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C6H3BrF3N/c7-5-2-1-4(3-11-5)6(8,9)10/h1-3H | | InChIKey | GSKMWMFOQQBVMI-UHFFFAOYSA-N | | SMILES | C1(Br)=NC=C(C(F)(F)F)C=C1 | | CAS DataBase Reference | 50488-42-1(CAS DataBase Reference) |
| Hazard Codes | T,Xi,Xn | | Risk Statements | 25-36/37/38-20/21/22 | | Safety Statements | 26-36/37/39-22-36 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | IRRITANT | | PackingGroup | Ⅲ | | HS Code | 29333990 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Bromo-5-(trifluoromethyl)pyridine Usage And Synthesis |
| Chemical Properties | Light yellow needles | | Uses | 2-Bromo-5-(trifluoromethyl)pyridine is substrate used in a palladium-catalyzed α-arylation of a Refomatsky reagent. | | Uses | 2-Bromo-5-(trifluoromethyl)pyridine is a substrate used in a palladium-catalyzed α-arylation of a Refomatsky reagent. |
| | 2-Bromo-5-(trifluoromethyl)pyridine Preparation Products And Raw materials |
|