|
|
| | 5-Chloropyridine-2-boronic acid Basic information |
| | 5-Chloropyridine-2-boronic acid Chemical Properties |
| Boiling point | 317.7±52.0 °C(Predicted) | | density | 1.41±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | powder | | pka | 7.66±0.53(Predicted) | | color | Off-white | | InChI | InChI=1S/C5H5BClNO2/c7-4-1-2-5(6(9)10)8-3-4/h1-3,9-10H | | InChIKey | JEGHCYRKSUGHJH-UHFFFAOYSA-N | | SMILES | B(C1=NC=C(Cl)C=C1)(O)O | | CAS DataBase Reference | 652148-91-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 37/38-41 | | Safety Statements | 26-39 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 5-Chloropyridine-2-boronic acid Usage And Synthesis |
| Uses | 5-Chloropyridine-2-boronic acid was used as reagent in organic synthesis. Also used as phamaceutical Intermediates. Used in suzuki-Miyaura coupling processes. |
| | 5-Chloropyridine-2-boronic acid Preparation Products And Raw materials |
|