|
|
| | 2-Bromo-3,5-dichloropyridine Basic information |
| Product Name: | 2-Bromo-3,5-dichloropyridine | | Synonyms: | 2-BROMO-3,5-DICHLOROPYRIDINE;3,5-DICHLOROPYRIDIN-2-YL-BORONIC ACID;3,5-DICHLORO-2-BROMOPYRIDINE;AKOS BBS-00001365;3,5-DICHLORO-2-BROMOPYRIDINE 98+%;5-Dichloro-2-broMopyridine;PYRIDINE, 2-BROMO-3,5-DICHLORO-;2-BROMO-3,5-DICHLOROPYRIDUNE | | CAS: | 14482-51-0 | | MF: | C5H2BrCl2N | | MW: | 226.89 | | EINECS: | 672-535-3 | | Product Categories: | Pyridine series;Halides;blocks;Bromides;Pyridines;Pyridines, Pyrimidines, Purines and Pteredines | | Mol File: | 14482-51-0.mol |  |
| | 2-Bromo-3,5-dichloropyridine Chemical Properties |
| Melting point | 40-42 | | Boiling point | 243.3±35.0 °C(Predicted) | | density | 1.848±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | -2.37±0.10(Predicted) | | form | Solid | | color | Pale brown | | InChI | InChI=1S/C5H2BrCl2N/c6-5-4(8)1-3(7)2-9-5/h1-2H | | InChIKey | QCKPJWDIDCGQRB-UHFFFAOYSA-N | | SMILES | C1(Br)=NC=C(Cl)C=C1Cl | | CAS DataBase Reference | 14482-51-0(CAS DataBase Reference) |
| Hazard Codes | Xi,T | | Risk Statements | 36/37/38-41-37/38-25 | | Safety Statements | 26-45-39 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Bromo-3,5-dichloropyridine Usage And Synthesis |
| Uses | 2-Bromo-3,5-dichloropyridine is used in various fields, including pharmaceuticals, agrochemicals, and materials science. It is an essential intermediate for the synthesis of different chemical compounds, such as fungicides, herbicides, and insecticides. | | Synthesis | Step 1: Synthesis of 2-bromo-3,5-dichloropyridine
To a solution of 3,5-dichloropyridin-2-amine (1.0 g, 6.2 mmol) dissolved in 40% aqueous hydrobromic acid (8 mL), bromine (2.8 g, 17 mmol) was slowly added dropwise at -20 °C. The resulting orange-colored suspension was stirred continuously for 2 hours at -20 °C. Subsequently, aqueous sodium nitrite (1.1 g, 17 mmol) was added at the same temperature. The reaction mixture was warmed up to ambient temperature and stirring was continued for 2 hours. Upon completion of the reaction, the mixture was cooled to 0 °C and the pH was adjusted with 30% aqueous sodium hydroxide solution to about 12. The reaction mixture was extracted with ether to give a light yellow organic phase. The organic phases were combined, washed with saturated sodium chloride solution, dried over anhydrous sodium sulfate and concentrated under reduced pressure to give the title compound 2-bromo-3,5-dichloropyridine as a yellow solid (730 mg, 52% yield).
1H NMR (400MHz, CDCl3) δ 8.27 (d, J=2.3Hz, 1H). | | References | [1] Patent: US4510148, 1985, A
[2] Patent: WO2008/70908, 2008, A1. Location in patent: Page/Page column 71-72
[3] Patent: WO2015/187845, 2015, A1. Location in patent: Paragraph 0239
[4] European Journal of Medicinal Chemistry, 1989, vol. 24, # 3, p. 249 - 258
[5] Phosphorus and Sulfur and the Related Elements, 1987, vol. 34, p. 123 - 132 |
| | 2-Bromo-3,5-dichloropyridine Preparation Products And Raw materials |
|