|
|
| | 3-O-METHYL-ALPHA-D-GLUCOPYRANOSE Basic information |
| | 3-O-METHYL-ALPHA-D-GLUCOPYRANOSE Chemical Properties |
| Melting point | 167-169 °C(lit.) | | alpha | +54~+58°(D/20℃) (c=1, dil. NH4OH) | | Boiling point | 250.62°C (rough estimate) | | density | 1.2501 (rough estimate) | | refractive index | 1.5600 (estimate) | | storage temp. | Sealed in dry,2-8°C | | solubility | DMSO (Slightly), Water (Slightly) | | pka | 12.05±0.70(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1/C7H14O6/c1-12-6-4(9)3(2-8)13-7(11)5(6)10/h3-11H,2H2,1H3/t3-,4-,5-,6+,7+/s3 | | InChIKey | SCBBSJMAPKXHAH-IHACGYQTNA-N | | SMILES | [C@@H]1(OC)[C@@H](O)[C@H](O[C@H](CO)[C@H]1O)O |&1:0,3,5,7,10,r| | | CAS DataBase Reference | 13224-94-7(CAS DataBase Reference) | | EPA Substance Registry System | .alpha.-D-Glucopyranose, 3-O-methyl- (13224-94-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-36-26 | | WGK Germany | 3 | | HS Code | 29400090 | | Storage Class | 11 - Combustible Solids |
| | 3-O-METHYL-ALPHA-D-GLUCOPYRANOSE Usage And Synthesis |
| Chemical Properties | white fine crystalline powder | | Uses | A labeled derivative of D-Glucose (G595000), used in enzymic synthesis of cyclohexyl-a and b-D-glucosides. |
| | 3-O-METHYL-ALPHA-D-GLUCOPYRANOSE Preparation Products And Raw materials |
|