|
|
| | Benzyl 2,3,4-tri-O-benzyl-α-D-glucopyranoside Basic information |
| Product Name: | Benzyl 2,3,4-tri-O-benzyl-α-D-glucopyranoside | | Synonyms: | Benzyl 2,3,4-tri-O-benzyl-alpha-D-glucopyranoside;1,2,3,4-TETRABENZYL-ALFA-D-GLUCOPYRANOSE;Benzyl 2,3,4-Tri-O-benzyl-α-D-glucopyranoside;((2R,3R,4S,5R,6S)-3,4,5,6-tetrakis(benzyloxy)tetrahydro-2H-pyran-2-yl)methanol;Benzyl 2,3,4-Tris-O-(phenylmethyl)-α-D-glucopyranoside;2,3,4-tri-O-benzyl-alpha-D-glucopyranoside;Benzyl 2,3,4-tri-O-benzyl-α-D-glucopyranoside | | CAS: | 59935-49-8 | | MF: | C34H36O6 | | MW: | 540.65 | | EINECS: | | | Product Categories: | | | Mol File: | 59935-49-8.mol |  |
| | Benzyl 2,3,4-tri-O-benzyl-α-D-glucopyranoside Chemical Properties |
| storage temp. | 2-8°C | | solubility | Chloroform; Dichloromethane | | form | Solid | | color | White | | InChIKey | HYWPIYGUZWWMDH-DLANKZEINA-N | | SMILES | [C@H]1(OCC2C=CC=CC=2)[C@H](OCC2=CC=CC=C2)[C@H](O[C@H](OCC2=CC=CC=C2)[C@@H]1OCC1=CC=CC=C1)CO |&1:0,9,18,20,29,r| |
| | Benzyl 2,3,4-tri-O-benzyl-α-D-glucopyranoside Usage And Synthesis |
| Uses | Benzyl 2,3,4-Tri-O-benzyl-α-D-glucopyranoside is a side product in the synthesis of Isomaltose-13C (I821252), which is labelled Isomaltose. One of the main product of transformation of maltose into prebiotic isomaltooligosaccharides by novel α-glucosidase from Xantophyllomyces dendrorhous. |
| | Benzyl 2,3,4-tri-O-benzyl-α-D-glucopyranoside Preparation Products And Raw materials |
|