- 2-Amino-6-bromophenol
-
- $900.00 / 500g
-
2024-02-15
- CAS:28165-50-6
- Min. Order: 1g
- Purity: 97
- Supply Ability: 500 Kg
- 2-Amino-6-bromophenol
-
- $15.00 / 1KG
-
2021-07-02
- CAS:28165-50-6
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
- 2-Amino-6-bromophenol
-
- $1.00 / 1KG
-
2019-07-06
- CAS:28165-50-6
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1
|
| | 2-Amino-6-bromophenol Basic information |
| Product Name: | 2-Amino-6-bromophenol | | Synonyms: | 3-BROMO-2-HYDROXYANILINE;2-AMINO-6-BROMOPHENOL;2-AMINO-6-BROMOPHENOL-97%;2-Amino-6-bromophenol ,98%;2-Amino-6-bromopheno;2-AMINO-6-BROMOPHENOL 2-Amino-6-bromophenol;Phenol, 2-aMino-6-broMo-;Eltrombopag Impurity 99 | | CAS: | 28165-50-6 | | MF: | C6H6BrNO | | MW: | 188.02 | | EINECS: | | | Product Categories: | | | Mol File: | 28165-50-6.mol |  |
| | 2-Amino-6-bromophenol Chemical Properties |
| Melting point | 83-84°C | | Boiling point | 246.4±25.0 °C(Predicted) | | density | 1.768±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | crystalline powder | | pka | 8.22±0.10(Predicted) | | color | Tan | | InChI | InChI=1S/C6H6BrNO/c7-4-2-1-3-5(8)6(4)9/h1-3,9H,8H2 | | InChIKey | LOBRHADLNRMHOO-UHFFFAOYSA-N | | SMILES | C1(O)=C(Br)C=CC=C1N | | CAS DataBase Reference | 28165-50-6(CAS DataBase Reference) |
| Hazard Codes | Xi,N,Xn | | Risk Statements | 22-50/53 | | Safety Statements | 60-61 | | WGK Germany | WGK 3 | | HS Code | 2922290090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| | 2-Amino-6-bromophenol Usage And Synthesis |
| Chemical Properties | Gray pwoder |
| | 2-Amino-6-bromophenol Preparation Products And Raw materials |
|