| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Eosin B, spirit soluble, pure
CAS:56360-46-4
Package:25GR
|
| Company Name: |
3B Pharmachem (Wuhan) International Co.,Ltd.
|
| Tel: |
821-50328103-801 18930552037 |
| Email: |
3bsc@sina.com |
| Products Intro: |
Product Name:EOSIN B
CAS:56360-46-4
Purity:99% HPLC Package:1Mg ; 5Mg;10Mg ;100Mg;250Mg ;500Mg ;1g;2.5g ;5g ;10g
|
|
| | EOSIN B Basic information |
| Product Name: | EOSIN B | | Synonyms: | 4,5-DIBROMO-2,7-DINITROFLUORESCEIN;4',5'-DIBROMO-2',7'-DINITROFLUORESCEIN DISODIUM SALT;4,5-DIBROMO-2,7-DINITROFLUORESCEIN DISODIUM SALT;ACID RED 91;EOSIN B;EOSIN BA OR BN;EOSIN B DISODIUM SALT;EOSIN BLUE SHADE | | CAS: | 56360-46-4 | | MF: | C20H8Br2N2O9 | | MW: | 580.09 | | EINECS: | 208-943-1 | | Product Categories: | Hematology and Histology;Hematology Stains | | Mol File: | 56360-46-4.mol |  |
| | EOSIN B Chemical Properties |
| Melting point | 275 °C (dec.)(lit.) | | Boiling point | 663.6±55.0 °C(Predicted) | | density | 2.27±0.1 g/cm3(Predicted) | | storage temp. | room temp | | solubility | soluble | | pka | 5.98±0.20(Predicted) | | form | Powder | | Colour Index | 45400 | | color | Orange | | PH Range | 1.4(colourless)-2.4(pink fluoresc.) | | ε(extinction coefficient) | ≥7000 at 515-521nm | | λmax | 522 nm | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C20H8Br2N2O9/c21-14-16(25)11(23(29)30)5-9-13(7-3-1-2-4-8(7)20(27)28)10-6-12(24(31)32)17(26)15(22)19(10)33-18(9)14/h1-6,25H,(H,27,28) | | InChIKey | YDIYPOHFEIEJPE-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccccc1C2=C3C=C(C(=O)C(Br)=C3Oc4c(Br)c(O)c(cc24)[N+]([O-])=O)[N+]([O-])=O | | CAS DataBase Reference | 56360-46-4 |
| Hazard Codes | Xn | | Risk Statements | 22-21/22 | | Safety Statements | 22-24/25-36/37 | | WGK Germany | 3 | | HS Code | 32041200 | | Storage Class | 11 - Combustible Solids |
| | EOSIN B Usage And Synthesis |
| Chemical Properties | orange powder | | Uses | diagnostic assay manufacturing
hematology
histology | | Definition | ChEBI: A C-nitro compound which consists of a fluorescein skeleton substituted by bromo groups at positions 4 and 5 and nitro groups at positions 2 and 7. |
| | EOSIN B Preparation Products And Raw materials |
|