|
|
| | 2,3,3',4,4',5,5',6-Octabromodiphenyl ether Basic information |
| Product Name: | 2,3,3',4,4',5,5',6-Octabromodiphenyl ether | | Synonyms: | 2,3,3μ,4,4μ,5,5μ,6-OctaBDE, PBDE 205, 2,3,3μ,4,4μ,5,5μ,6-Octabromodiphenyl ether solution;BDE No 205 solution;2,3,3',4,4',5,5',6-Octabromodiphenyl ether,50 ug/mL in Isooctane;(Pentabromophenyl)(3,4,5-tribromophenyl) ether;3,4,5-Tribromophenyl(pentabromophenyl) ether;BDE-205;1,2,3,4,5-PentabroMo-6-(3,4,5-tribroMophenoxy)benzene;2,3,3′,4,4′,5,5′,6-OctaBDE | | CAS: | 446255-56-7 | | MF: | C12H2Br8O | | MW: | 801.38 | | EINECS: | 208-759-1 | | Product Categories: | Aromatics, Pharmaceuticals, Intermediates & Fine Chemicals | | Mol File: | 446255-56-7.mol |  |
| | 2,3,3',4,4',5,5',6-Octabromodiphenyl ether Chemical Properties |
| Boiling point | 540.2±50.0 °C(Predicted) | | density | 2.768±0.06 g/cm3(Predicted) | | Fp | -12 °C | | storage temp. | 2-8°C | | Henry's Law Constant | 1.8×101 mol/(m3Pa) at 25℃, Long et al. (2017) | | Major Application | environmental | | InChI | 1S/C12H2Br8O/c13-4-1-3(2-5(14)6(4)15)21-12-10(19)8(17)7(16)9(18)11(12)20/h1-2H | | InChIKey | CVMKCYDBEYHNBM-UHFFFAOYSA-N | | SMILES | Brc1cc(Oc2c(Br)c(Br)c(Br)c(Br)c2Br)cc(Br)c1Br | | EPA Substance Registry System | PBDE 205 (446255-56-7) |
| Hazard Codes | F,Xn,N | | Risk Statements | 11-38-50/53-65-67 | | Safety Statements | 60-61-62-33-29-16-9 | | RIDADR | UN 1262 3/PG 2 | | WGK Germany | 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Asp. Tox. 1 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,3,3',4,4',5,5',6-Octabromodiphenyl ether Usage And Synthesis |
| Uses | 1,2,3,4,5-Pentabromo-6-(3,4,5-tribromophenoxy)benzene is a polybrominated diphenyl ethers (PBDEs) found as a contaminant in soil. |
| | 2,3,3',4,4',5,5',6-Octabromodiphenyl ether Preparation Products And Raw materials |
|