|
|
| | 2,4,4',6-Tetrabromodiphenyl ether Basic information |
| Product Name: | 2,4,4',6-Tetrabromodiphenyl ether | | Synonyms: | BDE-75;BDE NO 75;bde no 75solution;2,4,4μ,6-TetraBDE, 2,4,4μ,6-Tetrabromodiphenyl ether solution, PBDE 75;(2,4,6-Tribromophenyl)(4-bromophenyl) ether;2,4,6-Tribromophenyl 4-bromophenyl ether;1,3,5-Tribromo-2-(4-bromophenoxy)benzene;PBDE 75 | | CAS: | 189084-63-7 | | MF: | C12H6Br4O | | MW: | 485.79 | | EINECS: | 621-541-4 | | Product Categories: | | | Mol File: | 189084-63-7.mol |  |
| | 2,4,4',6-Tetrabromodiphenyl ether Chemical Properties |
| Fp | -12 °C | | storage temp. | 2-8°C | | Henry's Law Constant | 6.3×10-1 mol/(m3Pa) at 25℃, Long et al. (2017) | | Major Application | environmental | | InChI | 1S/C12H6Br4O/c13-7-1-3-9(4-2-7)17-12-10(15)5-8(14)6-11(12)16/h1-6H | | InChIKey | BWCNKMFFUGBFGB-UHFFFAOYSA-N | | SMILES | Brc1ccc(Oc2c(Br)cc(Br)cc2Br)cc1 | | EPA Substance Registry System | Benzene, 1,3,5-tribromo-2-(4-bromophenoxy)- (189084-63-7) |
| Hazard Codes | F,Xn,N | | Risk Statements | 11-38-50/53-65-67 | | Safety Statements | 60-61-62-33-29-16-9 | | RIDADR | UN 1262 3/PG 2 | | WGK Germany | WGK 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Asp. Tox. 1 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,4,4',6-Tetrabromodiphenyl ether Usage And Synthesis |
| Uses | 1,3,5-Tribromo-2-(4-bromophenoxy)benzene is a flame retardant incorporated into various consumer products to prevent flame propagation. |
| | 2,4,4',6-Tetrabromodiphenyl ether Preparation Products And Raw materials |
|
|
Tag:2,4,4',6-Tetrabromodiphenyl ether(189084-63-7)
Related Product Information
|
|
Decabromodiphenyl oxide
2,3',4,4',6-Pentabromodiphenyl ether
2,2',3,3',4,4',5,5',6-nonabromodiphenylether
2,4,4',6-Tetrabromodiphenyl ether
2,3,3',4,4',5,5',6-Octabromodiphenyl ether
2,3',4',6-Tetrabromodiphenyl ether
2,3,3',4,4',5,6-Heptabromodiphenyl ether
2,2',4,4',5,6'-Hexabromodiphenyl ether
2,2',4,5'-Tetrabromodiphenyl ether
2,23,4,45,6-Heptabromodiphenyl ether
2,2',4,4'-Tetrabromodiphenyl ether
2,2',3,4,4',5,6-Heptabromodiphenyl ether
2,2',4,4',6-Pentabromodiphenyl ether
2,3,4,5-Tetrabromodiphenyl ether
2,23,3Tetrabromodiphenyl ether
2,2',3,3',4,4',5,6-Octabromodiphenyl ether
2,2',3,4,4',5,5',6'-Octabromodiphenyl ether
2,2',3,3',4,4',5,6,6'-nonabde
|