|
|
| | 2,3',4',6-Tetrabromodiphenyl ether Basic information |
| Product Name: | 2,3',4',6-Tetrabromodiphenyl ether | | Synonyms: | PBDE 71;2,3',4',6-TETRABDE;bde no 71solution;2,3μ,4μ,6-TetraBDE, 2,3μ,4μ,6-Tetrabromodiphenyl ether solution, PBDE 71;(2,6-Dibromophenyl)(3,4-dibromophenyl) ether;2,6-Dibromophenyl 3,4-dibromophenyl ether;BDE-71;2,3,4,6-Tetrabromophenylphenyl ether | | CAS: | 189084-62-6 | | MF: | C12H6Br4O | | MW: | 485.79 | | EINECS: | 620-888-9 | | Product Categories: | | | Mol File: | 189084-62-6.mol |  |
| | 2,3',4',6-Tetrabromodiphenyl ether Chemical Properties |
| Fp | -12 °C | | storage temp. | 2-8°C | | Henry's Law Constant | 5.2×10-1 mol/(m3Pa) at 25℃, Long et al. (2017) | | Major Application | environmental | | InChI | 1S/C12H6Br4O/c13-8-5-4-7(6-11(8)16)17-12-9(14)2-1-3-10(12)15/h1-6H | | InChIKey | COPAGYRSCJVION-UHFFFAOYSA-N | | SMILES | Brc1ccc(Oc2c(Br)cccc2Br)cc1Br | | EPA Substance Registry System | Benzene, 1,3-dibromo-2-(3,4-dibromophenoxy)- (189084-62-6) |
| Hazard Codes | F,Xn,N | | Risk Statements | 11-38-50/53-65-67 | | Safety Statements | 60-61-62-33-29-16-9 | | RIDADR | UN 1262 3/PG 2 | | WGK Germany | 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Asp. Tox. 1
Flam. Liq. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,3',4',6-Tetrabromodiphenyl ether Usage And Synthesis |
| Uses | PBDE 71 is a related compound of PBDE 37 (P215200). PBDE 37 is a polybrominated diphenyl ether, an organobromine compound, used as a flame retardant in consumer products. PBDE 37 is also an environment pollutant that may lead to pregnancy failure. |
| | 2,3',4',6-Tetrabromodiphenyl ether Preparation Products And Raw materials |
|