- L-Hyp-Obzl.Hcl
-
-
2026-09-11
- CAS:62147-27-7
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
- H-Hyp-Obzl.HCl
-
- $2.00
-
2026-08-25
- CAS:62147-27-7
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
- H-HYP-OBZL HCL
-
- $6.60
-
2020-01-03
- CAS:62147-27-7
- Min. Order: 1KG
- Purity: 97%-99%
- Supply Ability: 1kg -1000kg
|
| | H-Hyp-OBzl HCl Basic information |
| Product Name: | H-Hyp-OBzl HCl | | Synonyms: | TRANS-4-HYDROXY-L-PROLINE ALPHA-BENZYL ESTER HYDROCHLORIDE;L-4-TRANS-HYDROXYPROLINE BENZYL ESTER HYDROCHLORIDE;L-4-HYDROXY-PROLINE BENZYL ESTER HYDROCHLORIDE;benzyl (2S,4R)-4-hydroxypyrrolidine-2-carboxylate hydrochloride;L-HYDROXYPROLINE BENZYL ESTER HYDROCHLORIDE;HYDROXYPROLINE-OBZL HCL;L-4-Hydroxy-proline benzyl ester hydrochloride >=98.0% (HPLC);Trans-L-4-Hydroxy-proline benzyl ester HCl | | CAS: | 62147-27-7 | | MF: | C12H15NO3.ClH | | MW: | 257.71 | | EINECS: | | | Product Categories: | Peptide Synthesis;Proline Derivatives;Unnatural Amino Acid Derivatives | | Mol File: | 62147-27-7.mol |  |
| | H-Hyp-OBzl HCl Chemical Properties |
| Melting point | 162-165 °C | | storage temp. | Inert atmosphere,2-8°C | | Appearance | White to off-white Solid | | Optical Rotation | [α]20/D 37±2°, c = 1% in methanol | | BRN | 3728745 | | Major Application | peptide synthesis | | InChI | InChI=1/C12H15NO3.ClH/c14-10-6-11(13-7-10)12(15)16-8-9-4-2-1-3-5-9;/h1-5,10-11,13-14H,6-8H2;1H/t10-,11+;/s3 | | InChIKey | LVYXMDJSWLEZMP-NFGOAHBONA-N | | SMILES | [C@@H]1(NC[C@H](O)C1)C(=O)OCC1C=CC=CC=1.Cl |&1:0,3,r| |
| WGK Germany | 3 | | F | 3-10 | | Storage Class | 13 - Non Combustible Solids |
| | H-Hyp-OBzl HCl Usage And Synthesis |
| Uses | L-4-Hydroxy-proline benzyl ester, HCl | | reaction suitability | reaction type: solution phase peptide synthesis |
| | H-Hyp-OBzl HCl Preparation Products And Raw materials |
|