| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- Cbz-D-Ala-Ol
-
-
2026-09-11
- CAS:61425-27-2
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | N-Benzyloxycarbonyl-D-alaninol Basic information |
| | N-Benzyloxycarbonyl-D-alaninol Chemical Properties |
| Melting point | 82-84°C | | Boiling point | 375.2±35.0 °C(Predicted) | | density | 1.149±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder or crystals | | pka | 11.90±0.46(Predicted) | | color | white | | Optical Rotation | [α]20/D +5.5°, c = 2 in ethanol | | Major Application | peptide synthesis | | InChI | 1S/C11H15NO3/c1-9(7-13)12-11(14)15-8-10-5-3-2-4-6-10/h2-6,9,13H,7-8H2,1H3,(H,12,14)/t9-/m1/s1 | | InChIKey | AFPHMHSLDRPUSM-SECBINFHSA-N | | SMILES | C[C@H](CO)NC(=O)OCc1ccccc1 | | CAS DataBase Reference | 61425-27-2(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29221990 | | Storage Class | 13 - Non Combustible Solids |
| | N-Benzyloxycarbonyl-D-alaninol Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | N-Benzyloxycarbonyl-D-alaninol Preparation Products And Raw materials |
|