- FMOC-L-2-Chlorophe
-
- $1.00
-
2019-07-06
- CAS:198560-41-7
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 100KG
|
| | FMOC-L-2-Chlorophe Basic information |
| | FMOC-L-2-Chlorophe Chemical Properties |
| Melting point | 158°C | | alpha | -46 º (c=1,EtOAc) | | Boiling point | 640.9±55.0 °C(Predicted) | | density | 1.337±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.72±0.11(Predicted) | | form | Powder | | color | White | | Optical Rotation | -70.5610°(C=1.0036g/100ml DMF) | | Major Application | peptide synthesis | | InChI | 1S/C24H20ClNO4/c25-21-12-6-1-7-15(21)13-22(23(27)28)26-24(29)30-14-20-18-10-4-2-8-16(18)17-9-3-5-11-19(17)20/h1-12,20,22H,13-14H2,(H,26,29)(H,27,28)/t22-/m0/s1 | | InChIKey | RNNKPNPLIMFSDY-QFIPXVFZSA-N | | SMILES | OC(=O)[C@H](Cc1ccccc1Cl)NC(=O)OCC2c3ccccc3-c4ccccc24 | | CAS DataBase Reference | 198560-41-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2924297099 | | Storage Class | 11 - Combustible Solids |
| | FMOC-L-2-Chlorophe Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Fmoc-L-2-chloroPhe-OH | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-L-2-Chlorophe Preparation Products And Raw materials |
|