|
|
| | M-CRESOL-D8 Basic information |
| Product Name: | M-CRESOL-D8 | | Synonyms: | M-CRESOL-D8;M-CRESOL-D8, 98 ATOM % D;3-Methylphenol-d8;m-Cresol-d8 in isopropanol;m-Cresol-d8 | | CAS: | 302911-90-6 | | MF: | C7D8O | | MW: | 116.19 | | EINECS: | | | Product Categories: | | | Mol File: | 302911-90-6.mol |  |
| | M-CRESOL-D8 Chemical Properties |
| Melting point | 8-10 °C(lit.) | | Boiling point | 203 °C(lit.) | | density | 1.126 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.538(lit.) | | Fp | 187 °F | | InChI | 1S/C7H8O/c1-6-3-2-4-7(8)5-6/h2-5,8H,1H3/i1D3,2D,3D,4D,5D/hD | | InChIKey | RLSSMJSEOOYNOY-IWRLGKISSA-N | | SMILES | [2H]Oc1c([2H])c([2H])c([2H])c(c1[2H])C([2H])([2H])[2H] |
| Hazard Codes | T | | Risk Statements | 23/24/25-34 | | Safety Statements | 23-26-36/37/39-45 | | RIDADR | UN 2076 6.1/PG 2 | | WGK Germany | 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Oral
Aquatic Chronic 3
Eye Dam. 1
Skin Corr. 1B |
| | M-CRESOL-D8 Usage And Synthesis |
| | M-CRESOL-D8 Preparation Products And Raw materials |
|