| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Z-GLY-PHE-OH manufacturers
- Z-GLY-PHE-OH
-
-
2025-12-24
- CAS:1170-76-9
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 10 tons
- Z-GLY-PHE-OH
-
- $1.00
-
2020-01-09
- CAS:1170-76-9
- Min. Order: 1g
- Purity: ≥98%
|
| | Z-GLY-PHE-OH Basic information |
| Product Name: | Z-GLY-PHE-OH | | Synonyms: | N-BENZYLOXYCARBONYLGLYCYL-L-PHENYLALANINE;Z-Gly-Phe-OH≥ 95% (HPLC);N-[(benzyloxy)carbonyl]glycylphenylalanine;N-CARBOBENZOXYGLYCYL-L-PHENYLALANINE;N-CBZGLYCYL-L-PHENYLALANINE;Z-L-GLYCYL-L-PHENYLALANINE;Z-GLYCYL-L-PHENYLALANINE;Z-GLY-PHE-OH | | CAS: | 1170-76-9 | | MF: | C19H20N2O5 | | MW: | 356.37 | | EINECS: | 214-626-9 | | Product Categories: | | | Mol File: | 1170-76-9.mol |  |
| | Z-GLY-PHE-OH Chemical Properties |
| Melting point | 125-126 °C | | Boiling point | 646.0±55.0 °C(Predicted) | | density | 1.278±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 3.54±0.10(Predicted) | | form | powder | | Optical Rotation | [α]20/D +40±1°, c = 2.5% in ethanol | | BRN | 2182728 | | Major Application | peptide synthesis | | InChI | 1S/C19H20N2O5/c22-17(12-20-19(25)26-13-15-9-5-2-6-10-15)21-16(18(23)24)11-14-7-3-1-4-8-14/h1-10,16H,11-13H2,(H,20,25)(H,21,22)(H,23,24)/t16-/m0/s1 | | InChIKey | FLGYJBNDDWLTQR-INIZCTEOSA-N | | SMILES | OC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)OCc2ccccc2 | | CAS DataBase Reference | 1170-76-9(CAS DataBase Reference) |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | Z-GLY-PHE-OH Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Substrate for carboxypeptidase A. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | Z-GLY-PHE-OH Preparation Products And Raw materials |
|