|
|
| | (R)-3-Aminomethyl-1-N-Boc-pyrrolidine Basic information |
| Product Name: | (R)-3-Aminomethyl-1-N-Boc-pyrrolidine | | Synonyms: | (R)-3-AMINOMETHYL-PYRROLIDINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER;(R)-1-N-BOC-3-(AMINOMETHYL)PYRROLIDINE;(R)-TERT-BUTYL-3-(AMINOMETHYL)PYRROLIDINE-1-CARBOXYLATE;(r)-n-boc-3-(aminomethyl)pyrrolidine;(3R)-3-(Aminomethyl)pyrrolidine, N1-BOC protected;tert-Butyl (3R)-3-(aminomethyl)pyrrolidine-1-carboxylate, (3R)-3-(Aminomethyl)-1-(tert-butoxycarbonyl)pyrrolidine;(3R)-3-Aminomethyl-1-Boc-pyrrolidine;REF DUPL: (R)-3-(Aminomethyl)-1-N-Boc-pyrrolidine | | CAS: | 199174-29-3 | | MF: | C10H20N2O2 | | MW: | 200.28 | | EINECS: | | | Product Categories: | pharmacetical;Pyrrole&Pyrrolidine&Pyrroline | | Mol File: | 199174-29-3.mol |  |
| | (R)-3-Aminomethyl-1-N-Boc-pyrrolidine Chemical Properties |
| Boiling point | 280.3±13.0 °C(Predicted) | | density | 1.044±0.06 g/cm3(Predicted) | | refractive index | 1.4780 | | storage temp. | 2-8°C | | pka | 10.12±0.29(Predicted) | | form | Liquid | | color | Colorless to yellow | | Optical Rotation | [α]/D -24.0±1.0°, c = 0.5 in chloroform | | Sensitive | Air Sensitive | | BRN | 10537871 | | InChI | InChI=1S/C10H20N2O2/c1-10(2,3)14-9(13)12-5-4-8(6-11)7-12/h8H,4-7,11H2,1-3H3/t8-/m1/s1 | | InChIKey | OGCCBDIYOAFOGK-MRVPVSSYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CC[C@H](CN)C1 | | CAS DataBase Reference | 199174-29-3(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-36-22 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | TSCA | No | | HS Code | 2933998090 | | Storage Class | 12 - Non Combustible Liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | (R)-3-Aminomethyl-1-N-Boc-pyrrolidine Usage And Synthesis |
| | (R)-3-Aminomethyl-1-N-Boc-pyrrolidine Preparation Products And Raw materials |
|