| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
2-Methoxy-N-methyaniline manufacturers
|
| | 2-Methoxy-N-methyaniline Basic information |
| | 2-Methoxy-N-methyaniline Chemical Properties |
| Melting point | 30-34 °C (lit.) | | Boiling point | 115 °C | | density | 1.032±0.06 g/cm3(Predicted) | | Fp | 209 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | solid | | pka | 4.80±0.10(Predicted) | | color | Pale yellow | | InChI | InChI=1S/C8H11NO/c1-9-7-5-3-4-6-8(7)10-2/h3-6,9H,1-2H3 | | InChIKey | KNZWULOUXYKBLH-UHFFFAOYSA-N | | SMILES | C1(NC)=CC=CC=C1OC |
| Hazard Codes | Xn | | Risk Statements | 22-43 | | Safety Statements | 36/37/39 | | WGK Germany | 2 | | HS Code | 29222990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |
| | 2-Methoxy-N-methyaniline Usage And Synthesis |
| Uses | As an organic synthesis intermediate, 2-methoxy-N-methylaniline can be used to synthesize various complex organic molecules, especially in the fields of medicine and pesticide chemistry. |
| | 2-Methoxy-N-methyaniline Preparation Products And Raw materials |
|