| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Amino-cyclohexyl-acetic acid Basic information |
| | Amino-cyclohexyl-acetic acid Chemical Properties |
| Melting point | 256 °C | | Boiling point | 293℃ | | density | 1.120 | | Fp | 131℃ | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 2.44±0.10(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C8H15NO2/c9-7(8(10)11)6-4-2-1-3-5-6/h6-7H,1-5,9H2,(H,10,11) | | InChIKey | WAMWSIDTKSNDCU-UHFFFAOYSA-N | | SMILES | C1(C(N)C(O)=O)CCCCC1 | | CAS DataBase Reference | 5664-29-9(CAS DataBase Reference) |
| Provider | Language |
|
ACROS
| English |
| | Amino-cyclohexyl-acetic acid Usage And Synthesis |
| Uses | Cyclohexylglycine is a Glycine (HY-Y0966) derivative[1]. | | References | [1] Luckose F, et al. Effects of amino acid derivatives on physical, mental, and physiological activities. Crit Rev Food Sci Nutr. 2015;55(13):1793-1144. DOI:10.1080/10408398.2012.708368 |
| | Amino-cyclohexyl-acetic acid Preparation Products And Raw materials |
|