|
|
| | 3-Bromo-4-methoxytoluene Basic information |
| | 3-Bromo-4-methoxytoluene Chemical Properties |
| Melting point | 15.5 °C(lit.) | | Boiling point | 124-125 °C20 mm Hg(lit.) | | density | 1.392 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.565(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | Specific Gravity | 1.41 | | color | Clear, dark yellow to brown | | InChI | InChI=1S/C8H9BrO/c1-6-3-4-8(10-2)7(9)5-6/h3-5H,1-2H3 | | InChIKey | DHPUIKWBNXTXOB-UHFFFAOYSA-N | | SMILES | C1(OC)=CC=C(C)C=C1Br | | CAS DataBase Reference | 22002-45-5(CAS DataBase Reference) | | EPA Substance Registry System | 2-Bromo-4-methylanisole (22002-45-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 2909309090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Bromo-4-methoxytoluene Usage And Synthesis |
| Chemical Properties | Clear colourless to light yellow liquid | | Uses | 2-Bromo-4-methylanisole may be used in the synthesis of:
- 1,6-bis(2-hydroxy-5-methylphenyl)pyridine (H2mdppy)
- 1,8-dimethoxy-4-methylanthra-quinone
- ethyl 2-(2-methoxy-5-methylphenyl)-2-methyl-4-oxocyclopentanecarboxylate
It may be used as starting material in the multi-step synthesis of sesquiterpene (±)-herbertenolide. | | Synthesis Reference(s) | Synthetic Communications, 23, p. 779, 1993 DOI: 10.1080/00397919308009839 | | General Description | 2-Bromo-4-methylanisole can be prepared via bromination of 4-methylanisole using poly(4-vinylpyridinium bromochromate). |
| | 3-Bromo-4-methoxytoluene Preparation Products And Raw materials |
|