H2N-PEG12-CH2CH2COOH manufacturers
- Amino-PEG12-acid
-
- $97.00
-
2026-07-15
- CAS:1415408-69-3
- Purity: 98.61%
- Supply Ability: 10g
- Amino-PEG12-COOH
-
-
2025-06-07
- CAS:1415408-69-3
- Min. Order: 100mg
- Purity: >95.00%
- Supply Ability: 100mg
|
| | H2N-PEG12-CH2CH2COOH Basic information |
| Product Name: | H2N-PEG12-CH2CH2COOH | | Synonyms: | 37-Amino-4,7,10,13,16,19,22,25,28,31,34,37-dodecaoxanonatriacontanoic acid;Amino-dPEG???-acid;Amino-PEG-12-acid,Amino PEG12 acid,inhibit,AminoPEG12acid,PROTAC Linkers,Inhibitor;H2N-PEG12-CH2CH2COOH/4,7,10,13,16,19,22,25,28,31,34,37-Dodecaoxanonatriacontanoic acid, 39-amino-;4,7,10,13,16,19,22,25,28,31,34,37-Dodecaoxanonatriacontanoic acid, 37-amino-;H2N-PEG12-CH2CH2COOH.HCL;NH2-PEG12-PA;H2N-PEG12-COOH | | CAS: | 1415408-69-3 | | MF: | C27H55NO14 | | MW: | 617.73 | | EINECS: | | | Product Categories: | | | Mol File: | 1415408-69-3.mol |  |
| | H2N-PEG12-CH2CH2COOH Chemical Properties |
| Boiling point | 665.8±55.0 °C(Predicted) | | density | 1.125±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | solubility | Soluble in Water, DMSO, DMF | | pka | 4.28±0.10(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C27H55NO14/c28-2-4-32-6-8-34-10-12-36-14-16-38-18-20-40-22-24-42-26-25-41-23-21-39-19-17-37-15-13-35-11-9-33-7-5-31-3-1-27(29)30/h1-26,28H2,(H,29,30) | | InChIKey | NLXRBQLQDLAFIM-UHFFFAOYSA-N | | SMILES | C(COCCOCCOCCC(=O)O)OCCOCCOCCOCCOCCOCCOCCOCCOCCN |
| | H2N-PEG12-CH2CH2COOH Usage And Synthesis |
| Description | Amino-PEG12-acid is an aqueous soluble PEG reagent. NH2 group is reactive with activated NHS esters, carbonyls (ketone, aldehyde) etc. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | | Uses | Amino-PEG12-Acid-Hydrochloride can be useful in enzymeless DNA base identification by chemical stepping in a nanopore. | | IC 50 | PEGs |
| | H2N-PEG12-CH2CH2COOH Preparation Products And Raw materials |
|