- 3-Nitrophenyl sulphone
-
- $7.00 / 1KG
-
2020-02-14
- CAS: 1228-53-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100kg
- 3-Nitrophenyl sulphone
-
- $7.00 / 1KG
-
2020-02-14
- CAS: 1228-53-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100kg
|
| | 3-Nitrophenyl sulphone Basic information |
| Product Name: | 3-Nitrophenyl sulphone | | Synonyms: | BIS(3-NITROPHENYL)SULFONE;BIS(3-NITROPHENYL)SULPHONE;BIS(M-NITROPHENYL) SULFONE;3,3'-DINITRODIPHENYLSULFONE;3,3'-DINITRODIPHENYLSULPHONE;3-Nitrophenyl sulphone;1,1'-sulfonylbis[3-nitro-benzen];1,1'-Sulfonylbis(3-nitrobenzene) | | CAS: | 1228-53-1 | | MF: | C12H8N2O6S | | MW: | 308.27 | | EINECS: | 214-965-2 | | Product Categories: | | | Mol File: | 1228-53-1.mol |  |
| | 3-Nitrophenyl sulphone Chemical Properties |
| Melting point | 252-255°C | | Boiling point | 200-201 °C | | density | 1.530±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | InChI | InChI=1S/C12H8N2O6S/c15-13(16)9-3-1-5-11(7-9)21(19,20)12-6-2-4-10(8-12)14(17)18/h1-8H | | InChIKey | AKAXCFAQCKRJOT-UHFFFAOYSA-N | | SMILES | S(C1=CC=CC([N+]([O-])=O)=C1)(C1=CC=CC([N+]([O-])=O)=C1)(=O)=O | | CAS DataBase Reference | 1228-53-1(CAS DataBase Reference) | | EPA Substance Registry System | Benzene, 1,1'-sulfonylbis[3-nitro- (1228-53-1) |
| RTECS | WR4700000 | | TSCA | TSCA listed |
| | 3-Nitrophenyl sulphone Usage And Synthesis |
| | 3-Nitrophenyl sulphone Preparation Products And Raw materials |
|