|
|
| | 3,3'-Sulfonyldianiline Basic information |
| | 3,3'-Sulfonyldianiline Chemical Properties |
| Melting point | 170-173 °C(lit.) | | Boiling point | 542.8±35.0 °C(Predicted) | | density | 1.2701 (rough estimate) | | vapor pressure | 0.002Pa at 20℃ | | refractive index | 1.5950 (estimate) | | storage temp. | Store below +30°C. | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 3.16±0.10(Predicted) | | form | Solid | | color | White | | Water Solubility | slightly soluble | | BRN | 2215938 | | InChI | 1S/C12H12N2O2S/c13-9-3-1-5-11(7-9)17(15,16)12-6-2-4-10(14)8-12/h1-8H,13-14H2 | | InChIKey | LJGHYPLBDBRCRZ-UHFFFAOYSA-N | | SMILES | Nc1cccc(c1)S(=O)(=O)c2cccc(N)c2 | | LogP | 0.76 at 25℃ | | CAS DataBase Reference | 599-61-1(CAS DataBase Reference) | | NIST Chemistry Reference | Benzenamine, 3,3'-sulfonylbis-(599-61-1) | | EPA Substance Registry System | Benzenamine, 3,3'-sulfonylbis- (599-61-1) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-37/39 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | RTECS | BY8800000 | | TSCA | TSCA listed | | HazardClass | 9 | | HS Code | 29309070 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 2
STOT RE 2 |
| | 3,3'-Sulfonyldianiline Usage And Synthesis |
| Chemical Properties | White to slightly yellow fine crystalline powder | | Uses | Bis(3-Aminophenyl) Sulfone is an impurity of Dapson (D193250), an antibacterial used in the treatment of dermatitis herpetiformis. | | Uses | 4,4'-diaminodiphenylsulfone be used for preparation polyimide and epoxy resin material. | | Uses | 3,3'-Diaminodiphenyl sulfone is used for curing agent for epoxy resin and also important monomer for polysulfonamide fiber(PSA). | | General Description | 3-Aminophenyl sulfone is an amine based curing agent that facilitates the formation of heat resistant epoxy based adhesive system. It has an amine hydrogen equivalent weight of 62. |
| | 3,3'-Sulfonyldianiline Preparation Products And Raw materials |
|