|
|
| | Fmoc-3-chloro-L-phenylalanine Basic information |
| | Fmoc-3-chloro-L-phenylalanine Chemical Properties |
| Boiling point | 640.9±55.0 °C(Predicted) | | density | 1.337±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | form | Solid | | pka | 3.70±0.10(Predicted) | | color | White to off-white | | InChI | 1S/C24H20ClNO4/c25-16-7-5-6-15(12-16)13-22(23(27)28)26-24(29)30-14-21-19-10-3-1-8-17(19)18-9-2-4-11-20(18)21/h1-12,21-22H,13-14H2,(H,26,29)(H,27,28)/t22-/m0/s1 | | InChIKey | UOZAKKJRIKXQPY-QFIPXVFZSA-N | | SMILES | O=C(N[C@H](C(O)=O)CC1=CC(Cl)=CC=C1)OCC(C2=C3C=CC=C2)C4=C3C=CC=C4 | | CAS DataBase Reference | 198560-44-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2922498590 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-3-chloro-L-phenylalanine Usage And Synthesis |
| Uses | Fmoc-3-Chloro-L-phenylalanine is a phenylalanine derivative[1]. | | References | [1] Luckose F, et al. Effects of amino acid derivatives on physical, mental, and physiological activities. Crit Rev Food Sci Nutr. 2015;55(13):1793-811. DOI:10.1080/10408398.2012.708368 |
| | Fmoc-3-chloro-L-phenylalanine Preparation Products And Raw materials |
|