- FMOC-L-3-Fluorophe
-
-
2025-04-04
- CAS:198560-68-8
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1ton
- FMOC-L-3-Fluorophe
-
- $10.00
-
2019-07-06
- CAS:198560-68-8
- Min. Order: 10KG
- Purity: 99%
- Supply Ability: 100kg
|
| | FMOC-L-3-Fluorophe Basic information |
| | FMOC-L-3-Fluorophe Chemical Properties |
| Melting point | 155.8 °C | | alpha | -39 º (c=1,DMF) | | Boiling point | 618.1±55.0 °C(Predicted) | | density | 1.2642 (estimate) | | storage temp. | 2-8°C | | form | solid | | pka | 3.70±0.10(Predicted) | | color | beige | | Major Application | peptide synthesis | | InChI | 1S/C24H20FNO4/c25-16-7-5-6-15(12-16)13-22(23(27)28)26-24(29)30-14-21-19-10-3-1-8-17(19)18-9-2-4-11-20(18)21/h1-12,21-22H,13-14H2,(H,26,29)(H,27,28)/t22-/m0/s1 | | InChIKey | DWSDVARCJDOADL-QFIPXVFZSA-N | | SMILES | FC1=CC=CC(C[C@H](NC(OCC2C3=C(C4=C2C=CC=C4)C=CC=C3)=O)C(O)=O)=C1 | | CAS DataBase Reference | 198560-68-8(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | Hazard Note | Harmful | | HazardClass | IRRITANT | | HS Code | 2922498590 | | Storage Class | 11 - Combustible Solids |
| | FMOC-L-3-Fluorophe Usage And Synthesis |
| Chemical Properties | white powder or chunks | | Uses | Phenylalanine derivative was introduced in collaboration with Yu and coworkers in reflection to a methodology reported in C-H Activation. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-L-3-Fluorophe Preparation Products And Raw materials |
|