- BOC-HIS(BZL)-OH
-
- $0.00 / 1kg
-
2025-04-04
- CAS:20898-44-6
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1Ton
- BOC-HIS(BZL)-OH
-
- $1.00 / 1KG
-
2020-01-19
- CAS:20898-44-6
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 100kg
|
| | BOC-HIS(BZL)-OH Basic information |
| Product Name: | BOC-HIS(BZL)-OH | | Synonyms: | N-ALPHA-BOC-NIM-BENZYL-L-HISTIDINE;N-ALPHA-TERT-BUTYLOXYCARBONYL-N-IM-BENZYL-L-HISTIDINE;NALPHA-T-BOC-NIM-BENZYL-L-HISTIDINE;BOC-N-IM-BENZYL-L-HISTIDINE;BOC-L-HIS(BZL)-OH;L-Histidine,N-[(1,1-dimethylethoxy)carbonyl]-1-(phenylmethyl)-;BOC-HIS(BZL)-OH(20898-44-6);(2S)-3-(1-benzylimidazol-4-yl)-2-(tert-butoxycarbonylamino)propanoic acid | | CAS: | 20898-44-6 | | MF: | C18H23N3O4 | | MW: | 345.39 | | EINECS: | 244-105-1 | | Product Categories: | Amino Acids | | Mol File: | 20898-44-6.mol |  |
| | BOC-HIS(BZL)-OH Chemical Properties |
| Melting point | 181-184 °C | | storage temp. | Sealed in dry,2-8°C | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]20/D +23±1°, c = 1% in methanol | | BRN | 710413 | | Major Application | peptide synthesis | | InChI | 1S/C18H23N3O4/c1-18(2,3)25-17(24)20-15(16(22)23)9-14-11-21(12-19-14)10-13-7-5-4-6-8-13/h4-8,11-12,15H,9-10H2,1-3H3,(H,20,24)(H,22,23)/t15-/m0/s1 | | InChIKey | OUHPNBGKEMHUCQ-HNNXBMFYSA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1cn(Cc2ccccc2)cn1)C(O)=O | | EPA Substance Registry System | L-Histidine, N-[(1,1-dimethylethoxy)carbonyl]-1-(phenylmethyl)- (20898-44-6) |
| WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2933.29.4300 | | Storage Class | 11 - Combustible Solids |
| | BOC-HIS(BZL)-OH Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-HIS(BZL)-OH Preparation Products And Raw materials |
|