|
|
| | BERYLLIUM 2,4-PENTANEDIONATE Basic information |
| Product Name: | BERYLLIUM 2,4-PENTANEDIONATE | | Synonyms: | (T-4)-bis(2,4-pentanedionato-O,O’)beryllium;Beryllium 2,4-pentadionate;Beryllium bis(acetylacetonate);Beryllium diacetylacetonate;Beryllium, bis(2,4-pentanedionato)-;Beryllium, bis(2,4-pentanedionato-O,O')-, (T-4)-;Bis(2,4-pentanedionato)beryllium;Bis(acetylacetonato)beryllium | | CAS: | 10210-64-7 | | MF: | C10H14BeO4 | | MW: | 207.23 | | EINECS: | 233-513-5 | | Product Categories: | 1 | | Mol File: | 10210-64-7.mol |  |
| | BERYLLIUM 2,4-PENTANEDIONATE Chemical Properties |
| Melting point | 100-104 °C(lit.) | | Boiling point | 270 °C(lit.) | | density | 1.168 g/mL at 25 °C(lit.) | | Fp | 270°C | | solubility | insoluble in H2O; very soluble in ethanol, ethyl ether | | form | Powder | | color | White | | Specific Gravity | 1.168 | | Water Solubility | insoluble H2O, hydrolyzed in boiling H2O [MER06]; very soluble alcohol, ether [HAW93] | | Hydrolytic Sensitivity | 5: forms reversible hydrate | | Merck | 13,1167 | | Exposure limits | ACGIH: TWA 0.00005 mg/m3
OSHA: Ceiling 2 μg/m3
NIOSH: IDLH 4 mg/m3; Ceiling 0.0005 mg/m3 | | InChI | InChI=1S/2C5H8O2.Be/c2*1-4(6)3-5(2)7;/h2*3,6H,1-2H3;/q;;+2/p-2/b2*4-3-; | | InChIKey | BBKXDHBLPBKCFR-FDGPNNRMSA-L | | SMILES | O([Be]O/C(/C)=C\C(=O)C)/C(/C)=C\C(=O)C |
| Hazard Codes | T+,N | | Risk Statements | 49-25-26-36/37/38-43-48/23-51/53 | | Safety Statements | 53-45-61 | | RIDADR | UN 1566 6.1/PG 2 | | WGK Germany | 3 | | TSCA | No | | HazardClass | 6.1 | | PackingGroup | II | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Inhalation
Acute Tox. 3 Oral
Aquatic Chronic 2
Carc. 1B Inhalation
Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1
STOT RE 1 Inhalation
STOT SE 3 |
| | BERYLLIUM 2,4-PENTANEDIONATE Usage And Synthesis |
| Chemical Properties | Crystalline powder. Freely soluble in alcohol and ether; slightly soluble in water. Resistant to hydrolysis. A chelating nonionizing compound. | | Hazard | Toxic. | | reaction suitability | core: beryllium |
| | BERYLLIUM 2,4-PENTANEDIONATE Preparation Products And Raw materials |
|