| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
1,4-Diethylpiperazine manufacturers
- 1,4-DIETHYLPIPERAZINE
-
- $1.10
-
2026-08-20
- CAS:6483-50-7
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons
- 1,4-Diethylpiperazine
-
- $1.00
-
2020-02-19
- CAS:6483-50-7
- Min. Order: 1KG
- Purity: 98% HPLC
- Supply Ability: 10 tons
|
| | 1,4-Diethylpiperazine Basic information |
| Product Name: | 1,4-Diethylpiperazine | | Synonyms: | 1,4-Diethylpiperazine,98%;1,4-Diethylpiperazine, 98% - See B24743;N,N'-Diethyl piperazine 1,4-Diethyl piperazine;TIMTEC-BB SBB008748;N,N'-DIETHYLPIPERAZINE;DEPP;N,N'-DIETHYLPIPERAZINE, 98%N,N'-DIETHYLPIPERAZINE, 98%N,N'-DIETHYLPIPERAZINE, 98%N,N'-DIETHYLPIPERAZINE, 98%;Piperazine, 1,4-diethyl- | | CAS: | 6483-50-7 | | MF: | C8H18N2 | | MW: | 142.24 | | EINECS: | 229-341-5 | | Product Categories: | | | Mol File: | 6483-50-7.mol |  |
| | 1,4-Diethylpiperazine Chemical Properties |
| Boiling point | 156-158 °C | | density | 0.9 | | refractive index | 1.453-1.455 | | storage temp. | 2-8°C | | solubility | Soluble in methanol, toluene. | | pka | 8.20±0.10(Predicted) | | InChI | InChI=1S/C16H21NO3.ClH/c1-17-12-7-8-13(17)10-14(9-12)20-16(19)15(18)11-5-3-2-4-6-11;/h2-6,12-15,18H,7-10H2,1H3;1H/t12-,13+,14+,15; | | InChIKey | DDPRYTUJYNYJKV-UHFFFAOYSA-N | | SMILES | N1(CCN(CC1)CC)CC | | CAS DataBase Reference | 6483-50-7(CAS DataBase Reference) | | EPA Substance Registry System | Piperazine, 1,4-diethyl- (6483-50-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | WGK Germany | WGK 3 | | HS Code | 29335995 | | Storage Class | 10 - Combustible liquids |
| | 1,4-Diethylpiperazine Usage And Synthesis |
| Chemical Properties | clear colorless to yellow liquid | | Uses | 1,4-Diethylpiperazine is used as pharmaceutical intermediate. |
| | 1,4-Diethylpiperazine Preparation Products And Raw materials |
| Raw materials | 1,2-Ethanediamine, N1,N2-diethyl-N1,N2-bis[2-(ethylamino)ethyl]--->1,4,7-Triethyldiethylenetriamine-->Ethyl potassium sulfate-->Piperazine, 1,4-diacetyl- (6CI,8CI,9CI)-->Ethylsulfuric acid sodium salt-->N,N'-Diethylethylenediamine-->Piperazine-->Ethanol-->1-Ethylpiperazine-->Diethylenetriamine-->Ethylamine |
|