- Diosbulbin B
-
- $35.00
-
2026-05-11
- CAS:20086-06-0
- Purity: 99.84%
- Supply Ability: 10g
- Diosbulbin B
-
-
2023-02-24
- CAS:20086-06-0
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
- Diosbulbin B
-
- $1.00
-
2019-07-06
- CAS: 20086-06-0
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 100KG
|
| | Diosbulbin B Basic information |
| Product Name: | Diosbulbin B | | Synonyms: | Diosbulbin B;(2R)-2-(3-Furyl)-1,2,6aβ,7,10,11,11aα,11b-octahydro-11bβ-methyl-4H-3aβ,6β:7β,10β-dimethanofuro[2,3-c]oxepino[4,5-e]oxepine-4,8(6H)-dione;Oroxylin A-7-glucoronide;(2R,3aS,6S,6aS,7R,10R,11aR,11bS)-2-(3-Furanyl)octahydro-11b-methyl-4H-3a,6:7,10-dimethanofuro[2,3-c]oxepino[4,5-e]oxepin-4,8(6H)-dione;4H-3a,6:7,10-Dimethanofuro[2,3-c]oxepino[4,5-e]oxepin-4,8(6H)-dione, 2-(3-furanyl)octahydro-11b-methyl-, (2R,3aS,6S,6aS,7R,10R,11aR,11bS)-;(2R,6S,6aS,7R,10R,11aR,11bS)-2-(furan-3-yl)-11b-methyloctahy...;(2R,6S,6aS,7R,10R,11aR,11bS)-2-(furan-3-yl)-11b-methyloctahydro-3a,6:7,10-dimethanofuro[2,3-c]oxepino[4,5-e]oxepine-4,8(6H)-dione;(2R,3aS,6S,6aS,7R,10R,11aR,11bS)-2-(Furan-3-yl)-11b-methyloctahydro-4H-3a,6:7,10-dimethanofuro[2,3-c]oxepino[4,5-e]oxepine-4,8(6H)-dione | | CAS: | 20086-06-0 | | MF: | C19H20O6 | | MW: | 344.36 | | EINECS: | | | Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract | | Mol File: | 20086-06-0.mol |  |
| | Diosbulbin B Chemical Properties |
| Melting point | 285 °C | | Boiling point | 574.8±50.0 °C(Predicted) | | density | 1.43 | | storage temp. | 2-8°C | | solubility | DMSO : 16 mg/mL (46.46 mM; Need ultrasonic) | | form | Powder | | color | White to off-white | | InChIKey | QEANLIISUSNNDX-YHPVUIEZSA-N | | SMILES | O1[C@@]2([H])C[C@@]3(O[C@@H](C4C=COC=4)C[C@@]3(C)[C@]3([H])C[C@]4([H])C[C@]([H])([C@]32[H])C(=O)O4)C1=O |
| | Diosbulbin B Usage And Synthesis |
| Chemical Properties | White crystalline powder, soluble in methanol, ethanol, DMSO and other organic solvents. | | Uses | Used for content determination/identification/pharmacological experiments, etc. | | Definition | ChEBI: Diosbulbin B is a naphthofuran. | | Biological Activity | Diosbulbin B is a diterpene lactone isolated from D. bulbifera L. with antitumor activity. Diosbulbin B can cause liver damage. | | Physiological effects | Diosbulbin B has an anticancer, hemostasis, bacteriostatic, and antiviral effects. | | target | P450 (e.g. CYP17) |
| | Diosbulbin B Preparation Products And Raw materials |
|