|
|
| | 2,6-Diisopropyl-1,4-benzoquinone Basic information |
| Product Name: | 2,6-Diisopropyl-1,4-benzoquinone | | Synonyms: | 2,6-dipropan-2-ylcyclohexa-2,5-diene-1,4-dione;Propofol EP Impurity J;Propofol Related Compound B (25 mg) (2,6-diisopropylbenzoquinone);2,6-Bis(1-Methylethyl)-2,5-cyclohexadiene-1,4-dione;2,6-Diisopropyl-p-benzoquinone;Propofol IMpurity J (EP);2,6-Diisopropylcyclohexa-2,5-diene-1,4-dione;2,6-diisopropylbenzoquinone | | CAS: | 1988-11-0 | | MF: | C12H16O2 | | MW: | 192.25 | | EINECS: | | | Product Categories: | Impurities;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 1988-11-0.mol |  |
| | 2,6-Diisopropyl-1,4-benzoquinone Chemical Properties |
| Boiling point | 130-131 °C(Press: 4-5 Torr) | | density | 1.032±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | liquid | | Appearance | Light yellow to brown Liquid | | Major Application | pharmaceutical small molecule | | InChI | 1S/C12H16O2/c1-7(2)10-5-9(13)6-11(8(3)4)12(10)14/h5-8H,1-4H3 | | InChIKey | DDXYWFGBQZICBD-UHFFFAOYSA-N | | SMILES | O=C1C(=CC(=O)C=C1C(C)C)C(C)C |
| WGK Germany | WGK 3 | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3
toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2,6-Diisopropyl-1,4-benzoquinone Usage And Synthesis |
| Chemical Properties | Yellow Oil | | Uses | Propofol (P829750) impurity. |
| | 2,6-Diisopropyl-1,4-benzoquinone Preparation Products And Raw materials |
|