- DMMT
-
- $120.00
-
2025-04-15
- CAS:61607-68-9
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 20ton
|
| | 1-[2-(Dimethylamino)ethyl]-1H-tetrazole-5-thiol Basic information | | Uses |
| Product Name: | 1-[2-(Dimethylamino)ethyl]-1H-tetrazole-5-thiol | | Synonyms: | 1-N,N-DIMETHYLAMINOETHYL-5-MERCAPTO-1H-TETRAZOLE;1-(2-DIMETHYLAMINOETHYL)-1H-TETRAZOLE-5-THIOL;1-(2-DIMETHYLAMINOETHYL)-5-MERCAPTO-1,2,3,4-TETRAZOLE;1-(2-DIMETHYLAMINOETHYL)-5-MERCAPTOTETRAZOLE;1,2'-DIMETHYLAMINO-ETHYL-5-MERCAPTO-TETRAZOLE;1-[2-(dimethylamino)ethyl]-1,2-dihydro-5h-tetrazole-5-thione;1-[2-(Dimethylamino)ethyl]-1H-tetrazole-5-thiol 98%;1-[2-(Dimethylamino)ethyl]-1H-tetrazole-5-thiol(MTZ) | | CAS: | 61607-68-9 | | MF: | C5H11N5S | | MW: | 173.24 | | EINECS: | 262-868-9 | | Product Categories: | Building Blocks;Heterocyclic Building Blocks;Tetrazoles | | Mol File: | 61607-68-9.mol | ![1-[2-(Dimethylamino)ethyl]-1H-tetrazole-5-thiol Structure](CAS/GIF/61607-68-9.gif) |
| | 1-[2-(Dimethylamino)ethyl]-1H-tetrazole-5-thiol Chemical Properties |
| Melting point | 215 °C (dec.)(lit.) | | Boiling point | 202.6±42.0 °C(Predicted) | | density | 1.36±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Methanol (Slightly), Water (Sparingly, Heated) | | form | Solid | | pka | 8.06±0.20(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C5H11N5S/c1-9(2)3-4-10-5(11)6-7-8-10/h3-4H2,1-2H3,(H,6,8,11) | | InChIKey | ODDAWJGQWOGBCX-UHFFFAOYSA-N | | SMILES | N1(CCN(C)C)C(=S)N=NN1 | | CAS DataBase Reference | 61607-68-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | 1325 | | WGK Germany | 3 | | HazardClass | 4.1 | | PackingGroup | III | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1-[2-(Dimethylamino)ethyl]-1H-tetrazole-5-thiol Usage And Synthesis |
| Uses | 1-(2-Dimethylaminoethyl)-5-mercaptotetrazole is an impurity of Cefotiam, a semi-synthetic cephalosporin antibiotic. | | Synthesis | 2-isocyanate-N, N-dimethylethanamine (1 mmol), and sodium azide (1 mmol) were stirred with 2 ml of 2-propanol and 2 ml of water for 3 hours at a temperature of 80°C. The solvent was removed by reducing pressure after acidification using 2N HCl. The desired form of the compound, 1-(2-dimethylamino)ethyl)-1H-tetrazole-5-thiol, was obtained with a yield of 84% by purifying with silica gel column chromatography using methanol and dichloromethane as developing solvents.
![1-[2-(Dimethylamino)ethyl]-1H-tetrazole-5-thiol 1-[2-(Dimethylamino)ethyl]-1H-tetrazole-5-thiol](/NewsImg/2023-12-01/6383702325966114244664106.jpg) |
| | 1-[2-(Dimethylamino)ethyl]-1H-tetrazole-5-thiol Preparation Products And Raw materials |
|