|
|
| | Kaempferol 3-(6-O-glucopyranosylglucoside) Basic information |
| Product Name: | Kaempferol 3-(6-O-glucopyranosylglucoside) | | Synonyms: | 2-(4-Hydroxyphenyl)-5,7-dihydroxy-3-[6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy]-4H-1-benzopyran-4-one;3-(6-O-β-D-Glucopyranosyl-β-D-glucopyranosyloxy)-4',5,7-trihydroxyflavone;3-[6-O-(β-D-Glucopyranosyl)-β-D-glucopyranosyloxy]-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one;Kaempferol 3-(6-O-glucopyranosylglucoside);Kaempferol 3-gentiobioside;Kaempferol-3-O-gentiobioside;6)-beta-D-glucosylkaempferol;aempferol 3-O-gentiobioside | | CAS: | 22149-35-5 | | MF: | C27H30O16 | | MW: | 610.52 | | EINECS: | | | Product Categories: | | | Mol File: | 22149-35-5.mol |  |
| | Kaempferol 3-(6-O-glucopyranosylglucoside) Chemical Properties |
| Melting point | 210-211℃ | | Boiling point | 991.0±65.0 °C(Predicted) | | density | 1.82±0.1 g/cm3(Predicted) | | solubility | Soluble in methanol; | | pka | 6.20±0.40(Predicted) | | form | powder | | color | Yellowish | | Water Solubility | insoluble in water | | InChIKey | BITPRCODIALMOV-DEFKTLOSSA-N | | SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O)OC[C@H]2O[C@H]([C@@H]([C@H]([C@@H]2O)O)O)Oc3[c](c4c([o]c3c5ccc(cc5)O)cc(cc4O)O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Kaempferol 3-(6-O-glucopyranosylglucoside) Usage And Synthesis |
| Chemical Properties | White crystalline powder, soluble in methanol, ethanol, DMSO and other organic solvents. | | Uses | Used for content determination/identification/pharmacological experiments, etc. | | Definition | ChEBI: Kaempferol 3-beta-gentiobioside is a kaempferol O-glucoside in which the hydroxy hydrogen at position 3 of kaempferol has been replaced by a gentiobiosyl group. It has a role as a Brassica napus metabolite. It is a disaccharide derivative, a kaempferol O-glucoside and a trihydroxyflavone. It is functionally related to a gentiobiose. | | Biological Activity | Kaempferol 3-O-gentiobioside is a flavonoid isolated from C. alata leaves with antidiabetic activity. It has anti-α-glucosidase activity and inhibits carbohydrase with IC50 of 50.0 μM. |
| | Kaempferol 3-(6-O-glucopyranosylglucoside) Preparation Products And Raw materials |
|