|
|
| | SEC-BUTYL METHYL ETHER Basic information |
| | SEC-BUTYL METHYL ETHER Chemical Properties |
| Melting point | -117.26°C (estimate) | | Boiling point | 75 °C(lit.) | | density | 0.742 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.372(lit.) | | Fp | −22 °F | | storage temp. | Refrigerator | | solubility | Chloroform, Methanol (Slightly) | | form | Colourless Liquid | | color | Colorless to Almost colorless | | Water Solubility | Miscible with water, alcohol, ether and acetone. | | Stability: | Volatile | | InChI | InChI=1S/C5H12O/c1-4-5(2)6-3/h5H,4H2,1-3H3 | | InChIKey | FVNIMHIOIXPIQT-UHFFFAOYSA-N | | SMILES | CC(OC)CC |
| Hazard Codes | F,Xi | | Risk Statements | 11 | | Safety Statements | 7-16-2017/7/16 | | RIDADR | UN 2350 3/PG 2 | | WGK Germany | 3 | | RTECS | KN5249500 | | Hazard Note | Irritant | | HazardClass | 3.1 | | PackingGroup | II | | HS Code | 29091990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 2 |
| | SEC-BUTYL METHYL ETHER Usage And Synthesis |
| Uses | sec-Butyl methyl ether is used as a solvent in organic synthesis. | | General Description | sec-Butyl methyl ether (2-methoxy butane) is an acyclic methyl ether. It is reported to be formed in trace amounts during the thermal decomposition of meso- and dl-2,3-dimethylsuccinyl peroxides. sec-Butyl methyl ether is prepared by the reaction of sodium sec-butylate and methyl iodide. Its boiling point has been predicted using back-propagation neural network (BP NN). | | structure and hydrogen bonding | A chemical structure of a molecule includes the arrangement of atoms and
the chemical bonds that hold the atoms together. The
SEC-BUTYL METHYL ETHER molecule contains a total of 17 bond(s). There are 5 non-H bond(s), 2 rotatable bond(s), and 1 ether(s)
(aliphatic).
 |
| | SEC-BUTYL METHYL ETHER Preparation Products And Raw materials |
|