| 
                    
                    1,3,5-TRIMETHOXY-2-NITROBENZENE manufacturers
                        2,4,6-Trimethoxynitrobenzene
                            
                                 $3.00 / 25KG
                            2025-10-13CAS:14227-18-0Min. Order: 0.1KGPurity:  99%Supply Ability: g-kg-tons, free sample is available | |  |  | 1,3,5-TRIMETHOXY-2-NITROBENZENE Basic information | 
 | Product Name: | 1,3,5-TRIMETHOXY-2-NITROBENZENE |  | Synonyms: | 1-NITRO-2,4,6-TRIMETHOXYBENZENE;2,4,6-TRIMETHOXYNITROBENZENE;2,4,6-Trimethoxybitrobenzene;2-Nitro-1,3,5-trimethoxybenzene~2,4,6-Trimethoxynitrobenzene;2-Nitro-1,3,5-trimethoxybenzene;2,4,6-Trimethoxynitrobenzene, 98+%;2,4,5-Trimethoxy Nitro Benzene;1,3,5-TRIMETHOXY-2-NITROBENZENE |  | CAS: | 14227-18-0 |  | MF: | C9H11NO5 |  | MW: | 213.19 |  | EINECS: | 000-000-0 |  | Product Categories: | Aromatic Ethers |  | Mol File: | 14227-18-0.mol |  |  | 
|  |  | 1,3,5-TRIMETHOXY-2-NITROBENZENE Chemical Properties | 
 | Melting point | 149-151 °C |  | Boiling point | 353.17°C (rough estimate) |  | density | 1.3707 (rough estimate) |  | refractive index | 1.5270 (estimate) |  | storage temp. | Sealed in dry,Room Temperature |  | form | crystalline powder |  | color | Yellow |  | Water Solubility | Soluble in water. |  | BRN | 2277262 |  | InChI | InChI=1S/C9H11NO5/c1-13-6-4-7(14-2)9(10(11)12)8(5-6)15-3/h4-5H,1-3H3 |  | InChIKey | VWYAWLZEMLQGJH-UHFFFAOYSA-N |  | SMILES | C1(OC)=CC(OC)=CC(OC)=C1[N+]([O-])=O |  | CAS DataBase Reference | 14227-18-0(CAS DataBase Reference) | 
| Hazard Codes | Xi |  | Hazard Note | Irritant |  | HS Code | 29093090 | 
|  |  | 1,3,5-TRIMETHOXY-2-NITROBENZENE Usage And Synthesis | 
 | Chemical Properties | yellow crystalline powder |  | Uses | 2,4,6-Trimethoxynitrobenzene is used as a chemicals, pharmaceutical intermediate, chemical research, application intermediate, pharmaceutical reagents. | 
|  |  | 1,3,5-TRIMETHOXY-2-NITROBENZENE Preparation Products And Raw materials | 
                 |