1,3,5-TRIMETHOXY-2-NITROBENZENE manufacturers
- 2,4,6-Trimethoxynitrobenzene
-
- $3.00 / 25KG
-
2026-04-17
- CAS:14227-18-0
- Min. Order: 0.1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 1,3,5-TRIMETHOXY-2-NITROBENZENE Basic information |
| Product Name: | 1,3,5-TRIMETHOXY-2-NITROBENZENE | | Synonyms: | 1-NITRO-2,4,6-TRIMETHOXYBENZENE;2,4,6-TRIMETHOXYNITROBENZENE;2,4,6-Trimethoxybitrobenzene;2-Nitro-1,3,5-trimethoxybenzene~2,4,6-Trimethoxynitrobenzene;2-Nitro-1,3,5-trimethoxybenzene;2,4,6-Trimethoxynitrobenzene, 98+%;2,4,5-Trimethoxy Nitro Benzene;1,3,5-TRIMETHOXY-2-NITROBENZENE | | CAS: | 14227-18-0 | | MF: | C9H11NO5 | | MW: | 213.19 | | EINECS: | 000-000-0 | | Product Categories: | Aromatic Ethers | | Mol File: | 14227-18-0.mol |  |
| | 1,3,5-TRIMETHOXY-2-NITROBENZENE Chemical Properties |
| Melting point | 149-151 °C | | Boiling point | 353.17°C (rough estimate) | | density | 1.3707 (rough estimate) | | refractive index | 1.5270 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | crystalline powder | | color | Yellow | | Water Solubility | Soluble in water. | | BRN | 2277262 | | InChI | InChI=1S/C9H11NO5/c1-13-6-4-7(14-2)9(10(11)12)8(5-6)15-3/h4-5H,1-3H3 | | InChIKey | VWYAWLZEMLQGJH-UHFFFAOYSA-N | | SMILES | C1(OC)=CC(OC)=CC(OC)=C1[N+]([O-])=O | | CAS DataBase Reference | 14227-18-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HS Code | 29093090 |
| | 1,3,5-TRIMETHOXY-2-NITROBENZENE Usage And Synthesis |
| Chemical Properties | yellow crystalline powder | | Uses | 2,4,6-Trimethoxynitrobenzene is used as a chemicals, pharmaceutical intermediate, chemical research, application intermediate, pharmaceutical reagents. |
| | 1,3,5-TRIMETHOXY-2-NITROBENZENE Preparation Products And Raw materials |
|