- 5-Hydroxyvanillin
-
- $1.00
-
2024-08-15
- CAS:3934-87-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20T
|
| | 5-Hydroxyvanillin Basic information |
| | 5-Hydroxyvanillin Chemical Properties |
| Melting point | 131-134°C | | Boiling point | 339.9±37.0 °C(Predicted) | | density | 1.378±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 7.63±0.23(Predicted) | | form | solid | | color | Light grey/ brown | | Cosmetics Ingredients Functions | HAIR DYEING | | InChI | InChI=1S/C8H8O4/c1-12-7-3-5(4-9)2-6(10)8(7)11/h2-4,10-11H,1H3 | | InChIKey | RRKMWVISRMWBAL-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC(OC)=C(O)C(O)=C1 | | LogP | 1.050 (est) | | CAS DataBase Reference | 3934-87-0(CAS DataBase Reference) | | NIST Chemistry Reference | 3,4-Dihydroxy-5-methoxybenzaldehyde(3934-87-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | CU5620000 | | HS Code | 2912490090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5-Hydroxyvanillin Usage And Synthesis |
| Chemical Properties | Crystallized. Melting point 130-131°C (132.5-134°C). | | Uses | 3,4-Dihydroxy-5-methoxybenzaldehyde may be used for the preparation of 3,4-dihydroxy-6-methoxy-β-nitrostyrene and 5-hydroxyconiferyl alcohol. | | Synthesis Reference(s) | Synthetic Communications, 18, p. 507, 1988 DOI: 10.1080/00397918808060744 | | General Description | 3,4-Dihydroxy-5-methoxybenzaldehyde can be obtained by reactting 5-iodovaniliin with sodium hydroxide and copper sulfate solution. | | Synthesis | The bromination reaction of vanillal and bromine generate 5-bromovanillal, which is then reacted with sodium hydroxide solution under the participation of copper powder to give 5-Hydroxyvanillin. |
| | 5-Hydroxyvanillin Preparation Products And Raw materials |
|