| Company Name: |
Honghanyanxin Pharm Gold |
| Tel: |
0551-62626652 19334025048 |
| Email: |
sales-honghanyanxin@aliyun.com |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
2-Bromo-4,6-difluoroaniline manufacturers
|
| | 2-Bromo-4,6-difluoroaniline Basic information |
| Product Name: | 2-Bromo-4,6-difluoroaniline | | Synonyms: | 4,6-Difluoro-2-bromoaniline;2-Bromo-4,6-difluoro;2-BroMo-4.6-2-fluoroaniline;2-BroMo-4,6-difluoraniline;2-BroMo-4,6-difluoroaniline 98%, 6-difluoroaniline 98%;6-BROMO-2,4-DIFLUOROANILINE;AKOS BBS-00003657;2,4-DIFLUORO-6-BROMOANILINE | | CAS: | 444-14-4 | | MF: | C6H4BrF2N | | MW: | 208 | | EINECS: | 429-430-0 | | Product Categories: | Fluorine series;Miscellaneous;Anilines, Amides & Amines;Bromine Compounds;Fluorine Compounds;Anilines, Aromatic Amines and Nitro Compounds | | Mol File: | 444-14-4.mol |  |
| | 2-Bromo-4,6-difluoroaniline Chemical Properties |
| Melting point | 41-42 °C (lit.) | | Boiling point | 208.0±35.0 °C(Predicted) | | density | 1.6953 (rough estimate) | | refractive index | 1.5320 (estimate) | | Fp | 177 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder to crystal | | pka | 1.20±0.10(Predicted) | | color | White to Green to Brown | | Water Solubility | Insoluble in water. | | BRN | 2718139 | | InChI | InChI=1S/C6H4BrF2N/c7-4-1-3(8)2-5(9)6(4)10/h1-2H,10H2 | | InChIKey | WUJKFVGKLTWVSQ-UHFFFAOYSA-N | | SMILES | C1(N)=C(F)C=C(F)C=C1Br | | CAS DataBase Reference | 444-14-4(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi,N | | Risk Statements | 20/21/22-36/37/38-51/53-22 | | Safety Statements | 26-36-36/37/39-61-25 | | RIDADR | UN 1325 4.1/PG 2 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 9 | | PackingGroup | III | | HS Code | 29214200 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Aquatic Chronic 2
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Bromo-4,6-difluoroaniline Usage And Synthesis |
| Chemical Properties | white crystalline low melting solid | | Uses | 2-Bromo-4,6-difluoroaniline is used in chemical synthesis. |
| | 2-Bromo-4,6-difluoroaniline Preparation Products And Raw materials |
|