| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Amino-(3-trifluoromethyl-phenyl)-acetic acid Basic information |
| Product Name: | Amino-(3-trifluoromethyl-phenyl)-acetic acid | | Synonyms: | (+/-)-2-AMINO-2-[3-(TRIFLUOROMETHYL)PHENYL]ACETIC ACID;3-(TRIFLUOROMETHYL)-DL-PHENYLGLYCINE;2-(3-TRIFLUOROMETHYL-PHENYL)-DL-GLYCINE;Benzeneacetic acid, a-aMino-3-(trifluoroMethyl)-;alpha-Amino-3-(trifluoromethyl)benzeneacetic acid;(2R)-2-ammonio-2-[3-(trifluoromethyl)phenyl]acetate;(2S)-amino[3-(trifluoromethyl)phenyl]ethanoicacid;2-[3-(TrifluoroMethyl)phenyl]glycine | | CAS: | 242475-26-9 | | MF: | C9H8F3NO2 | | MW: | 219.16 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 242475-26-9.mol |  |
| | Amino-(3-trifluoromethyl-phenyl)-acetic acid Chemical Properties |
| Boiling point | 274℃ | | density | 1.415 | | Fp | 120℃ | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | Solid | | pka | 1.79±0.10(Predicted) | | color | White to off-white | | Major Application | peptide synthesis | | InChI | 1S/C9H8F3NO2/c10-9(11,12)6-3-1-2-5(4-6)7(13)8(14)15/h1-4,7H,13H2,(H,14,15) | | InChIKey | SRHNOGZIXICHOU-UHFFFAOYSA-N | | SMILES | NC(C(O)=O)c1cccc(c1)C(F)(F)F | | CAS DataBase Reference | 242475-26-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2922498590 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Amino-(3-trifluoromethyl-phenyl)-acetic acid Usage And Synthesis |
| Uses | 2-Amino-2-(3-(trifluoromethyl)phenyl)acetic Acid is useful reagent for studying selective inhibitors of the interaction of individual nuclear hormone receptors. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | Amino-(3-trifluoromethyl-phenyl)-acetic acid Preparation Products And Raw materials |
|