6-Thioguanosine hydrate manufacturers
|
| | 6-Thioguanosine hydrate Basic information |
| Product Name: | 6-Thioguanosine hydrate | | Synonyms: | 6-Thioguanosine hydrate;2-Amino-6-mercapto-9(.beta.-D-ribofuranosyl)purin;2-amino-9-(3,4-dihydroxy-5-methylol-tetrahydrofuran-2-yl)-3H-purine-6-thione;2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)-2-tetrahydrofuranyl]-3H-purine-6-thione;(-)-2-AMino-6-Mercaptopurine riboside hydrate 98%;2-(2-amino-6-mercapto-9H-purin-9-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol;9H-Purine-6-thiol, 2-amino-9-.beta.-D-xylofuranosyl-, monohydrate;2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-6-thione | | CAS: | 345909-25-3 | | MF: | C10H13N5O4S | | MW: | 299.31 | | EINECS: | 201-597-2 | | Product Categories: | | | Mol File: | 345909-25-3.mol |  |
| | 6-Thioguanosine hydrate Chemical Properties |
| Melting point | 230-231 °C (dec.)(lit.) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Aqueous Base (Very Slightly), DMSO (Slightly) | | form | Solid | | color | Pale Yellow to Green | | Optical Rotation | [α]22/D 69.9°, c = 1.3 in 0.1 M NaOH | | Stability: | Hygroscopic | | InChI | 1S/C10H13N5O4S.H2O/c11-10-13-7-4(8(20)14-10)12-2-15(7)9-6(18)5(17)3(1-16)19-9;/h2-3,5-6,9,16-18H,1H2,(H3,11,13,14,20);1H2/t3-,5-,6-,9-;/m1./s1 | | InChIKey | CEMWFPKZUAKCRS-GWTDSMLYSA-N | | SMILES | [H]O[H].Nc1nc(S)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2n1 |
| Safety Statements | 24/25 | | WGK Germany | 3 | | RTECS | UP0200000 | | Storage Class | 11 - Combustible Solids |
| | 6-Thioguanosine hydrate Usage And Synthesis |
| Chemical Properties | Yellowish-beige powder | | Definition | ChEBI: 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-oxolanyl]-3H-purine-6-thione is a purine nucleoside. |
| | 6-Thioguanosine hydrate Preparation Products And Raw materials |
|