| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Barium 2-ethylhexanoate Basic information |
| | Barium 2-ethylhexanoate Chemical Properties |
| Melting point | >300℃ [ALD93] | | Fp | 25 °C | | storage temp. | Flammables area | | form | liquid | | Water Solubility | 172g/L at 20℃ | | InChI | 1S/2C8H16O2.Ba/c2*1-3-5-6-7(4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-2 | | InChIKey | VJFFDDQGMMQGTQ-UHFFFAOYSA-L | | SMILES | CCCCC(CC)C(=O)O[Ba]OC(=O)C(CC)CCCC | | EPA Substance Registry System | Barium 2-ethylhexanoate (2457-01-4) |
| Hazard Codes | Xn | | Risk Statements | 20/22 | | Safety Statements | 28 | | RIDADR | 2810 | | WGK Germany | 1 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29159000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Repr. 1B |
| | Barium 2-ethylhexanoate Usage And Synthesis |
| Chemical Properties | straw colored liquid | | Uses | Used in the preparation of thin-film superconductors. | | Flammability and Explosibility | Non flammable | | reaction suitability | core: barium |
| | Barium 2-ethylhexanoate Preparation Products And Raw materials |
|