LANTHANUM (III) 2-ETHYLHEXANOATE manufacturers
|
| | LANTHANUM (III) 2-ETHYLHEXANOATE Basic information |
| Product Name: | LANTHANUM (III) 2-ETHYLHEXANOATE | | Synonyms: | LANTHANUM 2-ETHYLHEXANOATE;LANTHANUM (III) 2-ETHYLHEXANOATE;lanthanum tris(2-ethylhexanoate);Lanthanum(III) 2-ethylhexanoate, 10% w/v in hexane;Tris(2-ethylhexanoic acid)lanthanum salt;Lanthanum(III) 2-ethylhexanoate solution, 10% w/v in hexane;LANTHANUM (III) 2-ETHYLHEXANOATE ISO 9001：2015 REACH;Lanthanum(Iii) 2-Ethylhexanoate w/v in Hexane | | CAS: | 67816-09-5 | | MF: | C8H16LaO2 | | MW: | 283.12 | | EINECS: | 267-212-5 | | Product Categories: | | | Mol File: | 67816-09-5.mol |  |
| | LANTHANUM (III) 2-ETHYLHEXANOATE Chemical Properties |
| Fp | <10℃ (tag closed test) | | form | Liquid | | Water Solubility | Soluble In Organic Solvents. Not miscible in water. | | Exposure limits | ACGIH: TWA 50 ppm (Skin)
OSHA: TWA 500 ppm(1800 mg/m3)
NIOSH: IDLH 1100 ppm; TWA 50 ppm(180 mg/m3) | | InChI | InChI=1S/C8H16O2.La/c1-3-5-6-7(4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10); | | InChIKey | ZVGIIEZOXFBDFO-UHFFFAOYSA-N | | SMILES | C(CC)(C(=O)O)CCCC.[La] | | EPA Substance Registry System | Hexanoic acid, 2-ethyl-, lanthanum(3+) salt (67816-09-5) |
| RIDADR | UN1208 | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | II |
| Provider | Language |
|
ALFA
| English |
| | LANTHANUM (III) 2-ETHYLHEXANOATE Usage And Synthesis |
| Uses | Petrochemical catalyst, Rubber manufacturing | | Uses | Lanthanum(III) 2-ethylhexanoate, 10% w/v in hexane is used as drier in ink, coatings and paint industry. |
| | LANTHANUM (III) 2-ETHYLHEXANOATE Preparation Products And Raw materials |
|